Organic acids and derivatives
Filtered Search Results
Diisopropyl methylphosphonate, 90%, Thermo Scientific Chemicals
CAS: 1445-75-6 Molecular Formula: C7H17O3P Molecular Weight (g/mol): 180.18 MDL Number: MFCD00015022 InChI Key: WOAFDHWYKSOANX-UHFFFAOYSA-N Synonym: diisopropyl methylphosphonate,diisopropyl methanephosphonate,bis 1-methylethyl methylphosphonate,unii-56v3og5dc7,methylphosphonic acid diisopropyl ester,phosphonic acid, methyl-, bis 1-methylethyl ester,phosphonic acid, methyl-, diisopropyl ester,methylphosphonic acid bis 1-methylethyl ester,dsstox_cid_4051,dsstox_rid_77269 PubChem CID: 3073 ChEBI: CHEBI:77325 IUPAC Name: 2-[methyl(propan-2-yloxy)phosphoryl]oxypropane SMILES: CC(C)OP(C)(=O)OC(C)C
| PubChem CID | 3073 |
|---|---|
| CAS | 1445-75-6 |
| Molecular Weight (g/mol) | 180.18 |
| ChEBI | CHEBI:77325 |
| MDL Number | MFCD00015022 |
| SMILES | CC(C)OP(C)(=O)OC(C)C |
| Synonym | diisopropyl methylphosphonate,diisopropyl methanephosphonate,bis 1-methylethyl methylphosphonate,unii-56v3og5dc7,methylphosphonic acid diisopropyl ester,phosphonic acid, methyl-, bis 1-methylethyl ester,phosphonic acid, methyl-, diisopropyl ester,methylphosphonic acid bis 1-methylethyl ester,dsstox_cid_4051,dsstox_rid_77269 |
| IUPAC Name | 2-[methyl(propan-2-yloxy)phosphoryl]oxypropane |
| InChI Key | WOAFDHWYKSOANX-UHFFFAOYSA-N |
| Molecular Formula | C7H17O3P |
2,2,3,3,4,4,5,5-Octafluoropentyl methacrylate, 98%, stab.
CAS: 355-93-1 Molecular Formula: C9H8F8O2 Molecular Weight (g/mol): 300.15 MDL Number: MFCD00039278 InChI Key: ZNJXRXXJPIFFAO-UHFFFAOYSA-N Synonym: 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate PubChem CID: 67739 IUPAC Name: 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F
| PubChem CID | 67739 |
|---|---|
| CAS | 355-93-1 |
| Molecular Weight (g/mol) | 300.15 |
| MDL Number | MFCD00039278 |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| Synonym | 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate |
| InChI Key | ZNJXRXXJPIFFAO-UHFFFAOYSA-N |
| Molecular Formula | C9H8F8O2 |
Sodium bromoacetate, 98%
CAS: 1068-52-6 Molecular Formula: C2H2BrNaO2 Molecular Weight (g/mol): 160.93 MDL Number: MFCD01311832 InChI Key: SESSOVUNEZQNBV-UHFFFAOYSA-M Synonym: sodium bromoacetate,sodium 2-bromoacetate,sodium monobromoacetate,unii-8j155ck8pv,acetic acid, bromo-, sodium salt,bromoacetic acid sodium salt,acmc-1bowb,sodium bromoacetate, ?brch2coona,acetic acid,bromo-,sodium salt 8ci,9ci,acetic acid, bromo-,sodium salt 8ci,9ci PubChem CID: 23675628 IUPAC Name: sodium;2-bromoacetate SMILES: C(C(=O)[O-])Br.[Na+]
| PubChem CID | 23675628 |
|---|---|
| CAS | 1068-52-6 |
| Molecular Weight (g/mol) | 160.93 |
| MDL Number | MFCD01311832 |
| SMILES | C(C(=O)[O-])Br.[Na+] |
| Synonym | sodium bromoacetate,sodium 2-bromoacetate,sodium monobromoacetate,unii-8j155ck8pv,acetic acid, bromo-, sodium salt,bromoacetic acid sodium salt,acmc-1bowb,sodium bromoacetate, ?brch2coona,acetic acid,bromo-,sodium salt 8ci,9ci,acetic acid, bromo-,sodium salt 8ci,9ci |
| IUPAC Name | sodium;2-bromoacetate |
| InChI Key | SESSOVUNEZQNBV-UHFFFAOYSA-M |
| Molecular Formula | C2H2BrNaO2 |
Taurine, ≥98.5%, Molecular Biology Grade, Ultrapure
CAS: 107-35-7 Molecular Formula: C2H7NO3S Molecular Weight (g/mol): 125.14 MDL Number: MFCD00008197 InChI Key: XOAAWQZATWQOTB-UHFFFAOYSA-N Synonym: taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid PubChem CID: 1123 ChEBI: CHEBI:15891 IUPAC Name: 2-aminoethanesulfonic acid SMILES: NCCS(O)(=O)=O
| PubChem CID | 1123 |
|---|---|
| CAS | 107-35-7 |
| Molecular Weight (g/mol) | 125.14 |
| ChEBI | CHEBI:15891 |
| MDL Number | MFCD00008197 |
| SMILES | NCCS(O)(=O)=O |
| Synonym | taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid |
| IUPAC Name | 2-aminoethanesulfonic acid |
| InChI Key | XOAAWQZATWQOTB-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO3S |
Ethyl indole-3-acrylate, 97%
CAS: 15181-86-9 Molecular Formula: C13H13NO2 Molecular Weight (g/mol): 215.252 MDL Number: MFCD00051947 InChI Key: OQJSITNIWIYWPU-FPLPWBNLSA-N Synonym: ethyl 2z-3-1h-indol-3-yl prop-2-enoate PubChem CID: 13863197 IUPAC Name: ethyl (Z)-3-(1H-indol-3-yl)prop-2-enoate SMILES: CCOC(=O)C=CC1=CNC2=CC=CC=C21
| PubChem CID | 13863197 |
|---|---|
| CAS | 15181-86-9 |
| Molecular Weight (g/mol) | 215.252 |
| MDL Number | MFCD00051947 |
| SMILES | CCOC(=O)C=CC1=CNC2=CC=CC=C21 |
| Synonym | ethyl 2z-3-1h-indol-3-yl prop-2-enoate |
| IUPAC Name | ethyl (Z)-3-(1H-indol-3-yl)prop-2-enoate |
| InChI Key | OQJSITNIWIYWPU-FPLPWBNLSA-N |
| Molecular Formula | C13H13NO2 |
Guanosine-5'-monophosphate, Free acid, ≥98%, MP Biomedicals™
CAS: 85-32-5 Molecular Formula: C10H14N5O8P Molecular Weight (g/mol): 363.223 InChI Key: RQFCJASXJCIDSX-UUOKFMHZSA-N Synonym: 5'-guanylic acid,guanosine monophosphate,guanylic acid,guanosine-5'-monophosphate,guanosine 5'-monophosphate,5'-gmp,guanosine 5'-phosphate,guanylate,guanidine monophosphate,guanosine-phosphate PubChem CID: 6804 ChEBI: CHEBI:17345 IUPAC Name: [(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate SMILES: C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)O)O)O)NC(=NC2=O)N
| PubChem CID | 6804 |
|---|---|
| CAS | 85-32-5 |
| Molecular Weight (g/mol) | 363.223 |
| ChEBI | CHEBI:17345 |
| SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)O)O)O)NC(=NC2=O)N |
| Synonym | 5'-guanylic acid,guanosine monophosphate,guanylic acid,guanosine-5'-monophosphate,guanosine 5'-monophosphate,5'-gmp,guanosine 5'-phosphate,guanylate,guanidine monophosphate,guanosine-phosphate |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChI Key | RQFCJASXJCIDSX-UUOKFMHZSA-N |
| Molecular Formula | C10H14N5O8P |
Phthalimide, 98%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 85-41-6 Molecular Formula: C8H5NO2 Molecular Weight (g/mol): 147.13 InChI Key: XKJCHHZQLQNZHY-UHFFFAOYSA-N IUPAC Name: 2,3-dihydro-1H-isoindole-1,3-dione SMILES: O=C1NC(=O)C2=CC=CC=C12
| CAS | 85-41-6 |
|---|---|
| Molecular Weight (g/mol) | 147.13 |
| SMILES | O=C1NC(=O)C2=CC=CC=C12 |
| IUPAC Name | 2,3-dihydro-1H-isoindole-1,3-dione |
| InChI Key | XKJCHHZQLQNZHY-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO2 |
1-Cyclohexene-1-acetic acid
CAS: 18294-87-6 Molecular Formula: C8H12O2 Molecular Weight (g/mol): 140.182 MDL Number: MFCD00015482 InChI Key: KDFBPHXESBPHTK-UHFFFAOYSA-N Synonym: 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid PubChem CID: 86699 IUPAC Name: 2-(cyclohexen-1-yl)acetic acid SMILES: C1CCC(=CC1)CC(=O)O
| PubChem CID | 86699 |
|---|---|
| CAS | 18294-87-6 |
| Molecular Weight (g/mol) | 140.182 |
| MDL Number | MFCD00015482 |
| SMILES | C1CCC(=CC1)CC(=O)O |
| Synonym | 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid |
| IUPAC Name | 2-(cyclohexen-1-yl)acetic acid |
| InChI Key | KDFBPHXESBPHTK-UHFFFAOYSA-N |
| Molecular Formula | C8H12O2 |
2,2,2-Trifluoroacetamide, 97%
CAS: 354-38-1 Molecular Formula: C2H2F3NO Molecular Weight (g/mol): 113.04 MDL Number: MFCD00008008 InChI Key: NRKYWOKHZRQRJR-UHFFFAOYSA-N Synonym: trifluoroacetamide,acetamide, 2,2,2-trifluoro,unii-36mu16byfk,n-trifluoroacetamide,2,2,2-trifluoro-acetamide,36mu16byfk,trifluroacetamide,trifluoro-acetamide,snylgqhjptadtaetp@,pubchem12622 PubChem CID: 67717 IUPAC Name: 2,2,2-trifluoroacetamide SMILES: NC(=O)C(F)(F)F
| PubChem CID | 67717 |
|---|---|
| CAS | 354-38-1 |
| Molecular Weight (g/mol) | 113.04 |
| MDL Number | MFCD00008008 |
| SMILES | NC(=O)C(F)(F)F |
| Synonym | trifluoroacetamide,acetamide, 2,2,2-trifluoro,unii-36mu16byfk,n-trifluoroacetamide,2,2,2-trifluoro-acetamide,36mu16byfk,trifluroacetamide,trifluoro-acetamide,snylgqhjptadtaetp@,pubchem12622 |
| IUPAC Name | 2,2,2-trifluoroacetamide |
| InChI Key | NRKYWOKHZRQRJR-UHFFFAOYSA-N |
| Molecular Formula | C2H2F3NO |
Dibenzyl phosphate, 98%
CAS: 1623-08-1 Molecular Formula: C14H15O4P Molecular Weight (g/mol): 278.244 MDL Number: MFCD00004775 InChI Key: HDFFVHSMHLDSLO-UHFFFAOYSA-N Synonym: dibenzyl phosphate,phosphoric acid dibenzyl ester,dibenzylphosphoric acid,unii-y65r35lz0s,phosphoric acid, bis phenylmethyl ester,dibenzylphosphate,creatine phosphate disodium impurity 4,dibenzyloxyphosphinic acid,dibenzyl-phosphate,pubchem14883 PubChem CID: 74189 IUPAC Name: dibenzyl hydrogen phosphate SMILES: C1=CC=C(C=C1)COP(=O)(O)OCC2=CC=CC=C2
| PubChem CID | 74189 |
|---|---|
| CAS | 1623-08-1 |
| Molecular Weight (g/mol) | 278.244 |
| MDL Number | MFCD00004775 |
| SMILES | C1=CC=C(C=C1)COP(=O)(O)OCC2=CC=CC=C2 |
| Synonym | dibenzyl phosphate,phosphoric acid dibenzyl ester,dibenzylphosphoric acid,unii-y65r35lz0s,phosphoric acid, bis phenylmethyl ester,dibenzylphosphate,creatine phosphate disodium impurity 4,dibenzyloxyphosphinic acid,dibenzyl-phosphate,pubchem14883 |
| IUPAC Name | dibenzyl hydrogen phosphate |
| InChI Key | HDFFVHSMHLDSLO-UHFFFAOYSA-N |
| Molecular Formula | C14H15O4P |
Mercury(II) trifluoromethanesulfonate, 98%
CAS: 49540-00-3 Molecular Formula: C2F6HgO6S2 Molecular Weight (g/mol): 498.718 MDL Number: MFCD00144746 InChI Key: BPVYMDMPLCOQPJ-UHFFFAOYSA-L Synonym: mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis PubChem CID: 2775250 IUPAC Name: mercury(2+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2]
| PubChem CID | 2775250 |
|---|---|
| CAS | 49540-00-3 |
| Molecular Weight (g/mol) | 498.718 |
| MDL Number | MFCD00144746 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2] |
| Synonym | mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis |
| IUPAC Name | mercury(2+);trifluoromethanesulfonate |
| InChI Key | BPVYMDMPLCOQPJ-UHFFFAOYSA-L |
| Molecular Formula | C2F6HgO6S2 |
Lithium trifluoroacetate monohydrate, 97%
CAS: 2923-17-3 Molecular Formula: C2F3LiO2 Molecular Weight (g/mol): 119.96 MDL Number: MFCD00013216,MFCD00149663 InChI Key: HSFDLPWPRRSVSM-UHFFFAOYSA-M Synonym: lithium trifluoroacetate,acetic acid, trifluoro-, lithium salt,lithium 2,2,2-trifluoroacetate,lithiumtrifluoroacetate,acmc-1cfal,lithotab trifluoroacetate,acetic acid, 2,2,2-trifluoro-, lithium salt 1:1,lithium trifluoroacetate, monohydrate,lithium 1+ trifluoroacetate,lithio 2,2,2-trifluoroacetate PubChem CID: 23661853 IUPAC Name: lithium;2,2,2-trifluoroacetate SMILES: [Li+].[O-]C(=O)C(F)(F)F
| PubChem CID | 23661853 |
|---|---|
| CAS | 2923-17-3 |
| Molecular Weight (g/mol) | 119.96 |
| MDL Number | MFCD00013216,MFCD00149663 |
| SMILES | [Li+].[O-]C(=O)C(F)(F)F |
| Synonym | lithium trifluoroacetate,acetic acid, trifluoro-, lithium salt,lithium 2,2,2-trifluoroacetate,lithiumtrifluoroacetate,acmc-1cfal,lithotab trifluoroacetate,acetic acid, 2,2,2-trifluoro-, lithium salt 1:1,lithium trifluoroacetate, monohydrate,lithium 1+ trifluoroacetate,lithio 2,2,2-trifluoroacetate |
| IUPAC Name | lithium;2,2,2-trifluoroacetate |
| InChI Key | HSFDLPWPRRSVSM-UHFFFAOYSA-M |
| Molecular Formula | C2F3LiO2 |
2-Cyano-3-methoxybenzeneboronic acid, 95%
CAS: 1164100-84-8 Molecular Formula: C8H8BNO3 Molecular Weight (g/mol): 176.97 MDL Number: MFCD10696671 InChI Key: GRHINHWGIHWEPE-UHFFFAOYSA-N Synonym: 2-cyano-3-methoxyphenyl boronic acid,acmc-2099sp,2-cyano-3-methoxyphenyl boronicacid PubChem CID: 53216734 IUPAC Name: (2-cyano-3-methoxyphenyl)boronic acid SMILES: COC1=CC=CC(B(O)O)=C1C#N
| PubChem CID | 53216734 |
|---|---|
| CAS | 1164100-84-8 |
| Molecular Weight (g/mol) | 176.97 |
| MDL Number | MFCD10696671 |
| SMILES | COC1=CC=CC(B(O)O)=C1C#N |
| Synonym | 2-cyano-3-methoxyphenyl boronic acid,acmc-2099sp,2-cyano-3-methoxyphenyl boronicacid |
| IUPAC Name | (2-cyano-3-methoxyphenyl)boronic acid |
| InChI Key | GRHINHWGIHWEPE-UHFFFAOYSA-N |
| Molecular Formula | C8H8BNO3 |
N,N-Dimethylformamide diethyl acetal, 95%
CAS: 1188-33-6 Molecular Formula: C7H17NO2 Molecular Weight (g/mol): 147.22 MDL Number: MFCD00009227 InChI Key: BWKAYBPLDRWMCJ-UHFFFAOYSA-N Synonym: n,n-dimethylformamide diethyl acetal,1,1-diethoxytrimethylamine,methanamine, 1,1-diethoxy-n,n-dimethyl,n,n-dimethyformamide diethy acetal,diethoxymethyl dimethylamine,n,n-dimethylformamide diethylacetal,dimethylformamide diethylacetal,1,1-diethoxy trimethyl amine,1,1-diethoxy-n,n-dimethylmethylamine,1,1-diethoxy-n,n-dimethyl-methanamine PubChem CID: 70913 IUPAC Name: 1,1-diethoxy-N,N-dimethylmethanamine SMILES: CCOC(N(C)C)OCC
| PubChem CID | 70913 |
|---|---|
| CAS | 1188-33-6 |
| Molecular Weight (g/mol) | 147.22 |
| MDL Number | MFCD00009227 |
| SMILES | CCOC(N(C)C)OCC |
| Synonym | n,n-dimethylformamide diethyl acetal,1,1-diethoxytrimethylamine,methanamine, 1,1-diethoxy-n,n-dimethyl,n,n-dimethyformamide diethy acetal,diethoxymethyl dimethylamine,n,n-dimethylformamide diethylacetal,dimethylformamide diethylacetal,1,1-diethoxy trimethyl amine,1,1-diethoxy-n,n-dimethylmethylamine,1,1-diethoxy-n,n-dimethyl-methanamine |
| IUPAC Name | 1,1-diethoxy-N,N-dimethylmethanamine |
| InChI Key | BWKAYBPLDRWMCJ-UHFFFAOYSA-N |
| Molecular Formula | C7H17NO2 |
Thermo Scientific Chemicals Diphenylamine-4-sulfonic acid, sodium salt, pure, redox-indicator grade
CAS: 6152-67-6 Molecular Formula: C12H11NNaO3S Molecular Weight (g/mol): 272.27 MDL Number: MFCD00036468 InChI Key: VMVSDVIYIMNZBS-UHFFFAOYSA-N Synonym: sodium 4-phenylamino benzenesulfonate,sodium diphenylamine-4-sulfonate,benzenesulfonic acid, 4-phenylamino-, monosodium salt,unii-3e2ux1382o,sodium 4-anilinobenzenesulfonate,diphenylamine-4-sulfonic acid sodium salt,sodium diphenylamine-p-sulfonate,n-phenylsulfanilic acid, sodium salt,4-phenylamino benzenesulfonic acid sodium salt,diphenylaminesulfonic acid sodium salt PubChem CID: 517002 SMILES: [Na].OS(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1
| PubChem CID | 517002 |
|---|---|
| CAS | 6152-67-6 |
| Molecular Weight (g/mol) | 272.27 |
| MDL Number | MFCD00036468 |
| SMILES | [Na].OS(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1 |
| Synonym | sodium 4-phenylamino benzenesulfonate,sodium diphenylamine-4-sulfonate,benzenesulfonic acid, 4-phenylamino-, monosodium salt,unii-3e2ux1382o,sodium 4-anilinobenzenesulfonate,diphenylamine-4-sulfonic acid sodium salt,sodium diphenylamine-p-sulfonate,n-phenylsulfanilic acid, sodium salt,4-phenylamino benzenesulfonic acid sodium salt,diphenylaminesulfonic acid sodium salt |
| InChI Key | VMVSDVIYIMNZBS-UHFFFAOYSA-N |
| Molecular Formula | C12H11NNaO3S |