Organic acids and derivatives
Medchemexpress LLC 2-Chloro-2-methylpropane-d9 | 918-20-7 | C4D9Cl | 1 G
2-Chloro-2-methylpropane-d9 is a deuterium labeled compound designed for research applications. It serves as a tracer and an internal standard for quantitative analysis using techniques like NMR, GC-MS, or LC-MS. Stable heavy isotopes of hydrogen, carbon, and other elements are incorporated into drug molecules, primarily as tracers for quantitation during drug development. Deuteration can impact the pharmacokinetic and metabolic profiles of drugs. This product has a molecular weight of 101.62, appears as a colorless to light yellow liquid, and has a purity of 97.83%.
- Used as a tracer
- Used as an internal standard for quantitative analysis by NMR, GC-MS, or LC-MS
- Contains stable heavy isotopes of hydrogen, carbon, and other elements
- Potential to affect pharmacokinetic and metabolic profiles of drugs
eMolecules 534-03-2 | 2-Aminopropane-1,3-diol | Apollo Scientific US - Building Blocks | MFCD00051487 | 91.110 | C3H9NO2 | 98.000 | NC(CO)CO | 500g | 398000212
2-Aminopropane-1,3-diol | Apollo Scientific US - Building Blocks | 534-03-2 | MFCD00051487 | 91.110 | C3H9NO2 | 98.000 | NC(CO)CO | 500g | 398000212
Aobchem 1-(2-Methoxyphenyl)-1 3-butanedione | ≥95% | CAS 56290-53-0 | C11H12O3 | 500mg
1-(2-Methoxyphenyl)-1 3-butanedione | ≥95% | CAS 56290-53-0 | C11H12O3 | 500mg
Aobchem 1-(4-Chlorophenyl)-2-methylpropan-1-ol | 95% | CAS 10400-18-7 | C10H13ClO | 5g
1-(4-Chlorophenyl)-2-methylpropan-1-ol | 95% | CAS 10400-18-7 | C10H13ClO | 5g
![eMolecules 1034558-51-4 | 1-Methyl-3-(3-sulfopropyl)-1H-imidazol-3-ium chloride | Ambeed240.700 | C7H13ClN2O3S | 95.000 | [Cl-].Cn1cc[n+](CCCS(O)(=O)=O)c1 | 1g | 660581064](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502424851.PNG-250.jpg)
eMolecules 1034558-51-4 | 1-Methyl-3-(3-sulfopropyl)-1H-imidazol-3-ium chloride | Ambeed240.700 | C7H13ClN2O3S | 95.000 | [Cl-].Cn1cc[n+](CCCS(O)(=O)=O)c1 | 1g | 660581064
1-Methyl-3-(3-sulfopropyl)-1H-imidazol-3-ium chloride | Ambeed | 1034558-51-4240.700 | C7H13ClN2O3S | 95.000 | [Cl-].Cn1cc[n+](CCCS(O)(=O)=O)c1 | 1g | 660581064
Aobchem 2-Chloro-N-methoxy-N-methylpropanamide | ≥95% | CAS 952579-60-1 | C5H10ClNO2 | 250mg
2-Chloro-N-methoxy-N-methylpropanamide | ≥95% | CAS 952579-60-1 | C5H10ClNO2 | 250mg
Aobchem Imidazole-1-sulfonic acid dimethyl amine | ≥95% | CAS 78162-58-0 | C5H9N3O2S | 10g
Imidazole-1-sulfonic acid dimethyl amine | ≥95% | CAS 78162-58-0 | C5H9N3O2S | 10g
Aobchem Butane-2 3-diol | ≥95% | CAS 513-85-9 | C4H10O2 | 500g
Butane-2 3-diol | ≥95% | CAS 513-85-9 | C4H10O2 | 500g
eMolecules 34604-52-9 | Ambeed | Oxybis(ethane-21-diyl) dimethanesulfonate | 5g | 528572899 | A829827 | MFCD01730454 | 262.29 | C6H14O7S2
ChemScene | 4-Methoxy-7H-pyrrolo[23-d]pyrimidin-2-amine | 250mg | 717419906 | CS-0100848 | 84955-32-8 | MFCD13178421 | 164.168 | C7H8N4O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Apexbio Technology LLC Butane diacid 110-15-6 100mg
Butane diacid also known as succinic acid (CAS 110-15-6) is a saturated dicarboxylic acid commonly utilized in biomedical research It participates in cellular metabolic pathways including the tricarboxylic acid (TCA) cycle where it functions as an intermediate involved in energy production and metabolic regulation Butane diacid is frequently employed to study mitochondrial respiration cellular energy metabolism and to investigate metabolic disorders The compound is water-soluble and should be stored in tightly sealed containers under cool dry conditions to maintain stability during experimental use
Medchemexpress LLC Camphor sulfonic acid methyl ester | 62319-13-5 | MFCD29045182 | 246.32 | C11H18O4S | 25 MG
Camphor sulfonic acid methyl ester is supplied as a research reagent and impurity standard for use in analytical and synthetic workflows. It is the methyl ester of camphorsulfonic acid (Methyl (1S)-(+)-10-camphorsulfonate) and is provided with storage instructions in the certificate of analysis.
- Contains methyl (1S)-(+)-10-camphorsulfonate (camphor sulfonic acid methyl ester).
- CAS number 62319-13-5.
- Chemical formula C11H18O4S; molecular weight 246.32.
- Intended for use as a camphor impurity or drug intermediate in research.
- Available in small pack sizes suitable for analytical and synthetic work (for example, 25 MG).
- Store under conditions specified in the certificate of analysis.
eMolecules Ms-PEG10-t-butyl ester | Broadpharm |664.800 | C28H56O15S | 96.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOS(C)(=O)=O | 250mg | 411413994
Ms-PEG10-t-butyl ester | Broadpharm |664.800 | C28H56O15S | 96.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOS(C)(=O)=O | 250mg | 411413994
Aobchem Benzenesulfonic acid 4-methyl- tetrahydro-2H-thiopyran-4-yl ester | ≥95% | CAS 27999-97-9 | C12H16O3S2 | 5g
Benzenesulfonic acid 4-methyl- tetrahydro-2H-thiopyran-4-yl ester | ≥95% | CAS 27999-97-9 | C12H16O3S2 | 5g
Aobchem 2-(4-Chlorophenyl)-2-methylpropanenitrile | ≥97% | CAS 30568-32-2 | C10H10ClN | 1g
2-(4-Chlorophenyl)-2-methylpropanenitrile | ≥97% | CAS 30568-32-2 | C10H10ClN | 1g