Cyclohexylamines
eMolecules 2769753-59-3 | Medchem Express | DB-0646 | 1mg | 722714228 | HY-137343 | 1041.066 | C52H51F3N14O7
Medchem Express | Deltaline | 5mg | 587658738 | HY-N0329 | 6836-11-9 | 507.624 | C27H41NO8
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Accela Chembio Inc MF: C8H18N2 | MW: 142.24 | ?97% | BP: 186.8 celsius at 760 mmHg.
MF: C8H18N2 | MW: 142.24 | ?97% | BP: 186.8 celsius at 760 mmHg.
![eMolecules 87583-89-9 | (S,S)-(+)-N,N??-Dimethyl-1,2-cyclohexanediamine | Ambeed | MFCD00671528 | 142.246 | C8H18N2 | 97 | CN[C@H]1CCCC[C@@H]1NC | 1g | 525160583](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00128114-NC2015386.JPG-250.jpg)
eMolecules 87583-89-9 | (S,S)-(+)-N,N??-Dimethyl-1,2-cyclohexanediamine | Ambeed | MFCD00671528 | 142.246 | C8H18N2 | 97 | CN[C@H]1CCCC[C@@H]1NC | 1g | 525160583
(S,S)-(+)-N,N??-Dimethyl-1,2-cyclohexanediamine | Ambeed | 87583-89-9 | MFCD00671528 | 142.246 | C8H18N2 | 97.000 | CN[C@H]1CCCC[C@@H]1NC | 1g | 525160583
eMolecules 201551-23-7 | Ambeed | NN-((1R2R)-cyclohexane-12-diyl)dipicolinamide | 250mg | 600829098 | A1250886 | MFCD02684543 | 324.384 | C18H20N4O2
Ambeed | 2-Methylthiazole | 1g | 552743720 | A563595 | 3581-87-1 | MFCD00053144 | 99.150 | C4H5NS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Sigma Aldrich Fine Chemicals Biosciences 5-Amino-1,3,3-Trimethylcyclohexanemethylamine, Mixture of Cis and Trans | 2855-13-2 | MFCD00019397 | 250ml
5-Amino-1,3,3-Trimethylcyclohexanemethylamine, Mixture of Cis and Trans | Purity: 99% | Mol Wt: 170.3 | 2855-13-2 | MFCD00019397 | 250ml
Aobchem 1-Bromo-2-[(4-methylcyclohexyl)oxy]benzene | 95% | CAS 1467404-38-1 | C13H17BrO | 10g
1-Bromo-2-[(4-methylcyclohexyl)oxy]benzene | 95% | CAS 1467404-38-1 | C13H17BrO | 10g
Aobchem 5-Bromo-2-[(4-methylcyclohexyl)oxy]pyridine | 97% | CAS 1249684-55-6 | C12H16BrNO | 25g
5-Bromo-2-[(4-methylcyclohexyl)oxy]pyridine | 97% | CAS 1249684-55-6 | C12H16BrNO | 25g
Aobchem 1-((2-Methylcyclohexyl)oxy)-4-nitrobenzene | 95% | CAS 2969205-98-7 | C13H17NO3 | 10g
1-((2-Methylcyclohexyl)oxy)-4-nitrobenzene | 95% | CAS 2969205-98-7 | C13H17NO3 | 10g
Aobchem 1-((2-Methylcyclohexyl)oxy)-4-nitrobenzene | 95% | CAS 2969205-98-7 | C13H17NO3 | 5g
1-((2-Methylcyclohexyl)oxy)-4-nitrobenzene | 95% | CAS 2969205-98-7 | C13H17NO3 | 5g
Accela Chembio Inc (1s | 2s)-(-)-1 | 2-diaminocyclohexane D-tartrate | 100g | 67333-70-4 | MFCD00191980 | 95+% | Shelf Life: 1800 Days | Moisture Sensitive
(1s | 2s)-(-)-1 | 2-diaminocyclohexane D-tartrate | 100g | 67333-70-4 | MFCD00191980 | 95+% | Shelf Life: 1800 Days | Moisture Sensitive
![Aobchem 1 1 -Methylenebis[4-bromobenzene] | ≥95% | CAS 1941-86-2 | C13H10Br2 | 5g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000976863.png-250.jpg)
Aobchem 1 1 -Methylenebis[4-bromobenzene] | ≥95% | CAS 1941-86-2 | C13H10Br2 | 5g
1 1 -Methylenebis[4-bromobenzene] | ≥95% | CAS 1941-86-2 | C13H10Br2 | 5g
![Aobchem 1 1 -Methylenebis[4-bromobenzene] | ≥95% | CAS 1941-86-2 | C13H10Br2 | 500mg](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000978981.png-250.jpg)
Aobchem 1 1 -Methylenebis[4-bromobenzene] | ≥95% | CAS 1941-86-2 | C13H10Br2 | 500mg
1 1 -Methylenebis[4-bromobenzene] | ≥95% | CAS 1941-86-2 | C13H10Br2 | 500mg
eMolecules 503859-27-6 | Methyl 3-amino-4-(cyclohexylamino)benzoate | Combi-Blocks | MFCD13343558 | 248.326 | C14H20N2O2 | 98.000 | COC(=O)c1ccc(NC2CCCCC2)c(N)c1 | 1g | 205414545
Methyl 3-amino-4-(cyclohexylamino)benzoate | Combi-Blocks | 503859-27-6 | MFCD13343558 | 248.326 | C14H20N2O2 | 98.000 | COC(=O)c1ccc(NC2CCCCC2)c(N)c1 | 1g | 205414545
![Aobchem 1 1 -Methylenebis[4-bromobenzene] | ≥95% | CAS 1941-86-2 | C13H10Br2 | 1g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000977128.png-250.jpg)
Aobchem 1 1 -Methylenebis[4-bromobenzene] | ≥95% | CAS 1941-86-2 | C13H10Br2 | 1g
1 1 -Methylenebis[4-bromobenzene] | ≥95% | CAS 1941-86-2 | C13H10Br2 | 1g