Quaternary ammonium salts
![eMolecules 1643-19-2 | Tetrabutylammonium bromide | Chem-Impex | MFCD00011633 | 322.375 | C16H36BrN | 98.000 | [Br-].CCCC[N+](CCCC)(CCCC)CCCC | 100g | 112442406](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000216579.jpg-250.jpg)
eMolecules 1643-19-2 | Tetrabutylammonium bromide | Chem-Impex | MFCD00011633 | 322.375 | C16H36BrN | 98.000 | [Br-].CCCC[N+](CCCC)(CCCC)CCCC | 100g | 112442406
Tetrabutylammonium bromide | Chem-Impex | 1643-19-2 | MFCD00011633 | 322.375 | C16H36BrN | 98.000 | [Br-].CCCC[N+](CCCC)(CCCC)CCCC | 100g | 112442406
Medchemexpress LLC Tetrapropylammonium iodide | 631-40-3 | 313.26 | 25 G
Tetrapropylammonium iodide is an organic compound widely utilized as an ionic liquid and catalyst. It serves multiple roles, including acting as a solvent in various chemical reactions and promoting organic synthesis reactions. Beyond its use in chemical synthesis, this compound finds extensive application in batteries, solar cells, and pigments.
- Organic compound
- Ionic liquid
- Catalyst
- Solvent
- Organic synthesis
- Broad applications
- Biochemical reagent
Medchemexpress LLC Tetramethylammonium bromide | 64-20-0 | MFCD00011626 | 98.0% | 154.05 g/mol | C4H12BrN | 100g
Tetramethylammonium bromide is a quaternary ammonium salt commonly used as a surfactant phase transfer catalyst and template molecule in various chemical reactions especially in organic synthesis and materials science Tetramethylammonium bromide has unique chemical properties that facilitate the transfer of ions or molecules from one phase to another making it an important ingredient in a variety of industrial processes
![eMolecules 56-34-8 | Tetraethylammonium chloride | Combi-Blocks | MFCD00011828 | 165.710 | C8H20ClN | 96.000 | [Cl-].CC[N+](CC)(CC)CC | 1kg | 335344684](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000129167.jpg-250.jpg)
eMolecules 56-34-8 | Tetraethylammonium chloride | Combi-Blocks | MFCD00011828 | 165.710 | C8H20ClN | 96.000 | [Cl-].CC[N+](CC)(CC)CC | 1kg | 335344684
Tetraethylammonium chloride | Combi-Blocks | 56-34-8 | MFCD00011828 | 165.710 | C8H20ClN | 96.000 | [Cl-].CC[N+](CC)(CC)CC | 1kg | 335344684
(F)F.CC[PH+](CC)CC | 1g | 321336666](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502169174.JPG-250.jpg)
eMolecules Triethylphosphonium tetrafluoroborate, 99% | Strem ChemicalsMFCD03788938 | 205.970 | C6H16BF4P | 99.000 | F[B-](F)(F)F.CC[PH+](CC)CC | 1g | 321336666
Triethylphosphonium tetrafluoroborate, 99% | Strem ChemicalsMFCD03788938 | 205.970 | C6H16BF4P | 99.000 | F[B-](F)(F)F.CC[PH+](CC)CC | 1g | 321336666
Medchemexpress LLC Tetrabutylammonium iodide | 311-28-4 | MFCD00011636 | ≥99.9% | 369.37 g·mol⁻¹ | C16H36IN | 1kg
Tetrabutylammonium iodide is a quaternary ammonium salt commonly used as a phase transfer catalyst surfactant and stabilizer in various chemical reactions especially in organic synthesis Tetrabutylammonium iodide has unique chemical properties that facilitate the transfer of ions or molecules from one phase to another making it an important ingredient in a variety of industrial processes
![eMolecules 1866-15-5 | Acetylthiocholine iodide | Chem-Impex | MFCD00011819 | 289.180 | C7H16INOS | 98.000 | [I-].CC(=O)SCC[N+](C)(C)C | 5g | 112756585](https://assets.fishersci.com/TFS-Assets/CCG/product-images/501715834.jpg-250.jpg)
eMolecules 1866-15-5 | Acetylthiocholine iodide | Chem-Impex | MFCD00011819 | 289.180 | C7H16INOS | 98.000 | [I-].CC(=O)SCC[N+](C)(C)C | 5g | 112756585
Acetylthiocholine iodide | Chem-Impex | 1866-15-5 | MFCD00011819 | 289.180 | C7H16INOS | 98.000 | [I-].CC(=O)SCC[N+](C)(C)C | 5g | 112756585