Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Sodium salicylate, 99%
CAS: 54-21-7 Molecular Formula: C7H5NaO3 Molecular Weight (g/mol): 160.104 MDL Number: MFCD00002440 InChI Key: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC Name: sodium;2-hydroxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
| PubChem CID | 16760658 |
|---|---|
| CAS | 54-21-7 |
| Molecular Weight (g/mol) | 160.104 |
| ChEBI | CHEBI:9180 |
| MDL Number | MFCD00002440 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| IUPAC Name | sodium;2-hydroxybenzoate |
| InChI Key | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO3 |
Paraffin Oil Light, MilliporeSigma™
CAS: 8012-95-1 Molecular Formula: MFCD00131611 Molecular Weight (g/mol): 0.00 MDL Number: MFCD00131611 InChI Key: FFNDMZIBVDSQFI-UHFFFAOYSA-N Synonym: delphinidin chloride,delphinidin,delphinidine,delphinidol,ephdine,delfinidol chloride,unii-em6md4aehe,ccris 2518,em6md4aehe,3,5,7-trihydroxy-2-3,4,5-trihydroxyphenyl benzopyrylium chloride PubChem CID: 68245 ChEBI: CHEBI:38701 IUPAC Name: 2-(3,4,5-trihydroxyphenyl)chromenylium-3,5,7-triol;chloride SMILES: *
| PubChem CID | 68245 |
|---|---|
| CAS | 8012-95-1 |
| Molecular Weight (g/mol) | 0.00 |
| ChEBI | CHEBI:38701 |
| MDL Number | MFCD00131611 |
| SMILES | * |
| Synonym | delphinidin chloride,delphinidin,delphinidine,delphinidol,ephdine,delfinidol chloride,unii-em6md4aehe,ccris 2518,em6md4aehe,3,5,7-trihydroxy-2-3,4,5-trihydroxyphenyl benzopyrylium chloride |
| IUPAC Name | 2-(3,4,5-trihydroxyphenyl)chromenylium-3,5,7-triol;chloride |
| InChI Key | FFNDMZIBVDSQFI-UHFFFAOYSA-N |
| Molecular Formula | MFCD00131611 |
Urea, 98+%
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Silicone oil, for oil baths, usable range from -40 to +200°C
CAS: 63148-62-9 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): NaN MDL Number: MFCD00132673 IUPAC Name: Polydimethylsiloxane SMILES: C[Si](C)(-*)O-*
| CAS | 63148-62-9 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00132673 |
| SMILES | C[Si](C)(-*)O-* |
| IUPAC Name | Polydimethylsiloxane |
| Molecular Formula | (C2H6OSi)n |
L-(+)-Ascorbic acid, 99+%
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
2-Methylbutane, 99+%
CAS: 78-78-4 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009338 InChI Key: QWTDNUCVQCZILF-UHFFFAOYSA-N Synonym: isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 PubChem CID: 6556 ChEBI: CHEBI:30362 IUPAC Name: 2-methylbutane SMILES: CCC(C)C
| PubChem CID | 6556 |
|---|---|
| CAS | 78-78-4 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:30362 |
| MDL Number | MFCD00009338 |
| SMILES | CCC(C)C |
| Synonym | isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 |
| IUPAC Name | 2-methylbutane |
| InChI Key | QWTDNUCVQCZILF-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Applied Biosystems™ POP-7™ Polymer, for 3500/SeqStudio™ Flex
POP-4, POP-6, and POP-7 are conveniently offered in easy to use pouch packages. The POP-7 separation matrix is optimized for short- to long-read sequencing and fragment analysis.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| For Use With (Application) | Long-Read Sequencing, Short Read Sequencing, Fragment Analysis (Denaturing) |
|---|---|
| Product Line | POP-7 |
Triethylamine 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 121-44-8 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.193 MDL Number: MFCD00009051 InChI Key: ZMANZCXQSJIPKH-UHFFFAOYSA-N Synonym: triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane PubChem CID: 8471 ChEBI: CHEBI:35026 IUPAC Name: N,N-diethylethanamine SMILES: CCN(CC)CC
| PubChem CID | 8471 |
|---|---|
| CAS | 121-44-8 |
| Molecular Weight (g/mol) | 101.193 |
| ChEBI | CHEBI:35026 |
| MDL Number | MFCD00009051 |
| SMILES | CCN(CC)CC |
| Synonym | triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane |
| IUPAC Name | N,N-diethylethanamine |
| InChI Key | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
1-Heptanesulfonic Acid Sodium Salt (HPLC), Fisher Chemical™
CAS: 22767-50-6 Molecular Formula: C7H15NaO3S MDL Number: MFCD00007543 InChI Key: REFMEZARFCPESH-UHFFFAOYSA-M PubChem CID: 23672332
| PubChem CID | 23672332 |
|---|---|
| CAS | 22767-50-6 |
| MDL Number | MFCD00007543 |
| InChI Key | REFMEZARFCPESH-UHFFFAOYSA-M |
| Molecular Formula | C7H15NaO3S |
Benzoyl chloride, 99+%
CAS: 98-88-4 Molecular Formula: C7H5ClO MDL Number: MFCD00000653 InChI Key: PASDCCFISLVPSO-UHFFFAOYSA-N Synonym: benzenecarbonyl chloride,benzoic acid, chloride,benzoylchloride,alpha-chlorobenzaldehyde,benzoic acid chloride,benzoylchlorid,benzaldehyde, alpha-chloro,a-chlorobenzaldehyde,ccris 802,unii-vty8706w36 PubChem CID: 7412 ChEBI: CHEBI:82275 IUPAC Name: benzoyl chloride
| PubChem CID | 7412 |
|---|---|
| CAS | 98-88-4 |
| ChEBI | CHEBI:82275 |
| MDL Number | MFCD00000653 |
| Synonym | benzenecarbonyl chloride,benzoic acid, chloride,benzoylchloride,alpha-chlorobenzaldehyde,benzoic acid chloride,benzoylchlorid,benzaldehyde, alpha-chloro,a-chlorobenzaldehyde,ccris 802,unii-vty8706w36 |
| IUPAC Name | benzoyl chloride |
| InChI Key | PASDCCFISLVPSO-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClO |
Hexamethylenetetramine, ACS, 99+%
CAS: 100-97-0 Molecular Formula: C6H12N4 Molecular Weight (g/mol): 140.19 MDL Number: MFCD00006895 InChI Key: VKYKSIONXSXAKP-UHFFFAOYSA-N Synonym: methenamine,hexamethylenetetramine,hexamine,urotropine,1,3,5,7-tetraazaadamantane,hexamethylenamine,aminoform,methenamin,urotropin,formamine PubChem CID: 4101 ChEBI: CHEBI:6824 SMILES: C1N2CN3CN1CN(C2)C3
| PubChem CID | 4101 |
|---|---|
| CAS | 100-97-0 |
| Molecular Weight (g/mol) | 140.19 |
| ChEBI | CHEBI:6824 |
| MDL Number | MFCD00006895 |
| SMILES | C1N2CN3CN1CN(C2)C3 |
| Synonym | methenamine,hexamethylenetetramine,hexamine,urotropine,1,3,5,7-tetraazaadamantane,hexamethylenamine,aminoform,methenamin,urotropin,formamine |
| InChI Key | VKYKSIONXSXAKP-UHFFFAOYSA-N |
| Molecular Formula | C6H12N4 |
1-Methyl-2-pyrrolidone 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 872-50-4 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.133 MDL Number: MFCD00003193 InChI Key: SECXISVLQFMRJM-UHFFFAOYSA-N Synonym: 1-methyl-2-pyrrolidinone,n-methyl-2-pyrrolidone,n-methylpyrrolidone,1-methyl-2-pyrrolidone,methylpyrrolidone,m-pyrol,n-methyl-2-pyrrolidinone,n-methylpyrrolidinone,1-methylpyrrolidinone,2-pyrrolidinone, 1-methyl PubChem CID: 13387 ChEBI: CHEBI:7307 IUPAC Name: 1-methylpyrrolidin-2-one SMILES: CN1CCCC1=O
| PubChem CID | 13387 |
|---|---|
| CAS | 872-50-4 |
| Molecular Weight (g/mol) | 99.133 |
| ChEBI | CHEBI:7307 |
| MDL Number | MFCD00003193 |
| SMILES | CN1CCCC1=O |
| Synonym | 1-methyl-2-pyrrolidinone,n-methyl-2-pyrrolidone,n-methylpyrrolidone,1-methyl-2-pyrrolidone,methylpyrrolidone,m-pyrol,n-methyl-2-pyrrolidinone,n-methylpyrrolidinone,1-methylpyrrolidinone,2-pyrrolidinone, 1-methyl |
| IUPAC Name | 1-methylpyrrolidin-2-one |
| InChI Key | SECXISVLQFMRJM-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
Sodium Tartrate Dihydrate (Colorless Crystals), Fisher BioReagents
CAS: 6106-24-7 | C4H8Na2O8 | 230.08 g/mol
| PubChem CID | 131855972 |
|---|---|
| CAS | 6106-24-7 |
| Molecular Weight (g/mol) | 230.08 |
| MDL Number | MFCD00150035 |
| SMILES | O.O.[Na+].[Na+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O |
| Synonym | unii-dia7c37aow,disodium tartrate dihydrate,disodium l-+-tartrate dihydrate,dia7c37aow,disodium +-tartrate dihydrate,sodium l-+-tartrate dihydrate,butanedioic acid, 2,3-dihydroxy-2r,3r-, disodium salt, dihydrate,disodium tartarate dihydrate,sodium tartrate nf,sodium tartrate dihydrate mi |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;sodium;dihydrate |
| InChI Key | FGJLAJMGHXGFDE-UDMGOBQRNA-L |
| Molecular Formula | C4H8Na2O8 |
Triethylamine (HPLC), Fisher Chemical™
CAS: 121-44-8 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.19 InChI Key: ZMANZCXQSJIPKH-UHFFFAOYSA-N IUPAC Name: triethylamine SMILES: CCN(CC)CC
| CAS | 121-44-8 |
|---|---|
| Molecular Weight (g/mol) | 101.19 |
| SMILES | CCN(CC)CC |
| IUPAC Name | triethylamine |
| InChI Key | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
Sulfanilic Acid Anhydrous (Crystalline/Certified ACS), Fisher Chemical
CAS: 121-57-3 Molecular Formula: C6H7NO3S Molecular Weight (g/mol): 173.186 MDL Number: MFCD00007886 InChI Key: HVBSAKJJOYLTQU-UHFFFAOYSA-N Synonym: sulfanilic acid,sulphanilic acid,p-aminobenzenesulfonic acid,sulfanilsaeure,aniline-4-sulfonic acid,benzenesulfonic acid, 4-amino,aniline-p-sulfonic acid,aniline-p-sulphonic acid,p-aminophenylsulfonic acid,sulfanilicacid PubChem CID: 8479 ChEBI: CHEBI:27500 IUPAC Name: 4-aminobenzenesulfonic acid SMILES: C1=CC(=CC=C1N)S(=O)(=O)O
| PubChem CID | 8479 |
|---|---|
| CAS | 121-57-3 |
| Molecular Weight (g/mol) | 173.186 |
| ChEBI | CHEBI:27500 |
| MDL Number | MFCD00007886 |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)O |
| Synonym | sulfanilic acid,sulphanilic acid,p-aminobenzenesulfonic acid,sulfanilsaeure,aniline-4-sulfonic acid,benzenesulfonic acid, 4-amino,aniline-p-sulfonic acid,aniline-p-sulphonic acid,p-aminophenylsulfonic acid,sulfanilicacid |
| IUPAC Name | 4-aminobenzenesulfonic acid |
| InChI Key | HVBSAKJJOYLTQU-UHFFFAOYSA-N |
| Molecular Formula | C6H7NO3S |