Organic acids and derivatives
Filtered Search Results
Ethyl alpha-Cyanocinnamate 98.0+%, TCI America™
CAS: 2025-40-3 Molecular Formula: C12H11NO2 Molecular Weight (g/mol): 201.225 MDL Number: MFCD00009137 InChI Key: KCDAMWRCUXGACP-FLIBITNWSA-N Synonym: 2-Cyano-3-phenylacrylic Acid Ethyl Ester, alpha-Cyanocinnamic Acid Ethyl Ester, Ethyl 2-Cyano-3-phenylacrylate PubChem CID: 5354392 IUPAC Name: ethyl (Z)-2-cyano-3-phenylprop-2-enoate SMILES: CCOC(=O)C(=CC1=CC=CC=C1)C#N
| PubChem CID | 5354392 |
|---|---|
| CAS | 2025-40-3 |
| Molecular Weight (g/mol) | 201.225 |
| MDL Number | MFCD00009137 |
| SMILES | CCOC(=O)C(=CC1=CC=CC=C1)C#N |
| Synonym | 2-Cyano-3-phenylacrylic Acid Ethyl Ester, alpha-Cyanocinnamic Acid Ethyl Ester, Ethyl 2-Cyano-3-phenylacrylate |
| IUPAC Name | ethyl (Z)-2-cyano-3-phenylprop-2-enoate |
| InChI Key | KCDAMWRCUXGACP-FLIBITNWSA-N |
| Molecular Formula | C12H11NO2 |
2,2,3,4,4,4-Hexafluorobutyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
CAS: 36405-47-7 Molecular Formula: C8H8F6O2 Molecular Weight (g/mol): 250.14 MDL Number: MFCD00042311 InChI Key: DFVPUWGVOPDJTC-UHFFFAOYSA-N Synonym: 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer PubChem CID: 549772 IUPAC Name: 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F
| PubChem CID | 549772 |
|---|---|
| CAS | 36405-47-7 |
| Molecular Weight (g/mol) | 250.14 |
| MDL Number | MFCD00042311 |
| SMILES | CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F |
| Synonym | 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate |
| InChI Key | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| Molecular Formula | C8H8F6O2 |
Methyl Chlorodifluoroacetate 97.0+%, TCI America™
CAS: 1514-87-0 Molecular Formula: C3H3ClF2O2 Molecular Weight (g/mol): 144.502 MDL Number: MFCD00000775 InChI Key: AWUPLMYXZJKHEG-UHFFFAOYSA-N Synonym: methyl chlorodifluoroacetate,chlorodifluoroacetic acid methyl ester,acetic acid, chlorodifluoro-, methyl ester,methyl difluorochloroacetic acid,methyl chloro difluoro acetate,acetic acid, 2-chloro-2,2-difluoro-, methyl ester,methyl-2-chloro-2,2-difluoroacetate,chloro-difluoro-acetic acid methyl ester,clcf2coome,clcf2co2me PubChem CID: 73935 IUPAC Name: methyl 2-chloro-2,2-difluoroacetate SMILES: COC(=O)C(F)(F)Cl
| PubChem CID | 73935 |
|---|---|
| CAS | 1514-87-0 |
| Molecular Weight (g/mol) | 144.502 |
| MDL Number | MFCD00000775 |
| SMILES | COC(=O)C(F)(F)Cl |
| Synonym | methyl chlorodifluoroacetate,chlorodifluoroacetic acid methyl ester,acetic acid, chlorodifluoro-, methyl ester,methyl difluorochloroacetic acid,methyl chloro difluoro acetate,acetic acid, 2-chloro-2,2-difluoro-, methyl ester,methyl-2-chloro-2,2-difluoroacetate,chloro-difluoro-acetic acid methyl ester,clcf2coome,clcf2co2me |
| IUPAC Name | methyl 2-chloro-2,2-difluoroacetate |
| InChI Key | AWUPLMYXZJKHEG-UHFFFAOYSA-N |
| Molecular Formula | C3H3ClF2O2 |
Benzyl Tiglate 97.0+%, TCI America™
CAS: 37526-88-8 Molecular Formula: C12H14O2 Molecular Weight (g/mol): 190.24 MDL Number: MFCD00017279 InChI Key: QRGSTISKDZCDHV-XCVCLJGOSA-N Synonym: benzyl tiglate,benzyl 2-methylcrotonate,benzyl trans-2,3-dimethylacrylate,e-benzyl 2-methylbut-2-enoate,benzyl trans-2-methyl-2-butenoate,unii-67uep899rr,benzyl 2-methyl-2-butenoate,benzyl trans-2-methylcrotonate,tiglic acid benzyl ester,benzyltiglate PubChem CID: 250096 IUPAC Name: benzyl (2E)-2-methylbut-2-enoate SMILES: C\C=C(/C)C(=O)OCC1=CC=CC=C1
| PubChem CID | 250096 |
|---|---|
| CAS | 37526-88-8 |
| Molecular Weight (g/mol) | 190.24 |
| MDL Number | MFCD00017279 |
| SMILES | C\C=C(/C)C(=O)OCC1=CC=CC=C1 |
| Synonym | benzyl tiglate,benzyl 2-methylcrotonate,benzyl trans-2,3-dimethylacrylate,e-benzyl 2-methylbut-2-enoate,benzyl trans-2-methyl-2-butenoate,unii-67uep899rr,benzyl 2-methyl-2-butenoate,benzyl trans-2-methylcrotonate,tiglic acid benzyl ester,benzyltiglate |
| IUPAC Name | benzyl (2E)-2-methylbut-2-enoate |
| InChI Key | QRGSTISKDZCDHV-XCVCLJGOSA-N |
| Molecular Formula | C12H14O2 |
sec-Butyl Crotonate 97.0+%, TCI America™
CAS: 10371-45-6 Molecular Formula: C8H14O2 Molecular Weight (g/mol): 142.198 MDL Number: MFCD00059054 InChI Key: KAKJZWSUVDRWQU-GQCTYLIASA-N Synonym: Crotonic Acid sec-Butyl Ester PubChem CID: 5366041 IUPAC Name: butan-2-yl (E)-but-2-enoate SMILES: CCC(C)OC(=O)C=CC
| PubChem CID | 5366041 |
|---|---|
| CAS | 10371-45-6 |
| Molecular Weight (g/mol) | 142.198 |
| MDL Number | MFCD00059054 |
| SMILES | CCC(C)OC(=O)C=CC |
| Synonym | Crotonic Acid sec-Butyl Ester |
| IUPAC Name | butan-2-yl (E)-but-2-enoate |
| InChI Key | KAKJZWSUVDRWQU-GQCTYLIASA-N |
| Molecular Formula | C8H14O2 |
Methyl 2-Chloropropionate 95.0+%, TCI America™
CAS: 17639-93-9 Molecular Formula: C4H7ClO2 Molecular Weight (g/mol): 122.55 MDL Number: MFCD00000863 InChI Key: JLEJCNOTNLZCHQ-UHFFFAOYNA-N Synonym: methyl 2-chloropropionate,propanoic acid, 2-chloro-, methyl ester,2-chloropropionic acid methyl ester,propionic acid, 2-chloro-, methyl ester,methyl alpha-chloropropionate,methyl .alpha.-chloropropionate,.alpha.-chloropropionic acid methyl ester,propanoic acid, 2-chloro-, methyl ester, s,ch3chclc o och3,acmc-1bl6f PubChem CID: 28659 IUPAC Name: methyl 2-chloropropanoate SMILES: COC(=O)C(C)Cl
| PubChem CID | 28659 |
|---|---|
| CAS | 17639-93-9 |
| Molecular Weight (g/mol) | 122.55 |
| MDL Number | MFCD00000863 |
| SMILES | COC(=O)C(C)Cl |
| Synonym | methyl 2-chloropropionate,propanoic acid, 2-chloro-, methyl ester,2-chloropropionic acid methyl ester,propionic acid, 2-chloro-, methyl ester,methyl alpha-chloropropionate,methyl .alpha.-chloropropionate,.alpha.-chloropropionic acid methyl ester,propanoic acid, 2-chloro-, methyl ester, s,ch3chclc o och3,acmc-1bl6f |
| IUPAC Name | methyl 2-chloropropanoate |
| InChI Key | JLEJCNOTNLZCHQ-UHFFFAOYNA-N |
| Molecular Formula | C4H7ClO2 |
Methyl (R)-(+)-2-Chloropropionate 98.0+%, TCI America™
CAS: 77287-29-7 Molecular Formula: C4H7ClO2 Molecular Weight (g/mol): 122.548 MDL Number: MFCD00062940 InChI Key: JLEJCNOTNLZCHQ-GSVOUGTGSA-N Synonym: (R)-(+)-2-Chloropropionic Acid Methyl Ester PubChem CID: 149593 IUPAC Name: methyl (2R)-2-chloropropanoate SMILES: CC(C(=O)OC)Cl
| PubChem CID | 149593 |
|---|---|
| CAS | 77287-29-7 |
| Molecular Weight (g/mol) | 122.548 |
| MDL Number | MFCD00062940 |
| SMILES | CC(C(=O)OC)Cl |
| Synonym | (R)-(+)-2-Chloropropionic Acid Methyl Ester |
| IUPAC Name | methyl (2R)-2-chloropropanoate |
| InChI Key | JLEJCNOTNLZCHQ-GSVOUGTGSA-N |
| Molecular Formula | C4H7ClO2 |
Methyl (S)-(-)-2-Chloropropionate 98.0+%, TCI America™
CAS: 73246-45-4 Molecular Formula: C4H7ClO2 Molecular Weight (g/mol): 122.55 MDL Number: MFCD00062941 InChI Key: JLEJCNOTNLZCHQ-VKHMYHEASA-N Synonym: (S)-(-)-2-Chloropropionic Acid Methyl Ester PubChem CID: 135535 IUPAC Name: methyl (2S)-2-chloropropanoate SMILES: COC(=O)[C@H](C)Cl
| PubChem CID | 135535 |
|---|---|
| CAS | 73246-45-4 |
| Molecular Weight (g/mol) | 122.55 |
| MDL Number | MFCD00062941 |
| SMILES | COC(=O)[C@H](C)Cl |
| Synonym | (S)-(-)-2-Chloropropionic Acid Methyl Ester |
| IUPAC Name | methyl (2S)-2-chloropropanoate |
| InChI Key | JLEJCNOTNLZCHQ-VKHMYHEASA-N |
| Molecular Formula | C4H7ClO2 |
Methyl Bromoacetate 98.0+%, TCI America™
CAS: 96-32-2 Molecular Formula: C3H5BrO2 Molecular Weight (g/mol): 152.975 MDL Number: MFCD00000189 InChI Key: YDCHPLOFQATIDS-UHFFFAOYSA-N Synonym: methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech PubChem CID: 60984 IUPAC Name: methyl 2-bromoacetate SMILES: COC(=O)CBr
| PubChem CID | 60984 |
|---|---|
| CAS | 96-32-2 |
| Molecular Weight (g/mol) | 152.975 |
| MDL Number | MFCD00000189 |
| SMILES | COC(=O)CBr |
| Synonym | methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech |
| IUPAC Name | methyl 2-bromoacetate |
| InChI Key | YDCHPLOFQATIDS-UHFFFAOYSA-N |
| Molecular Formula | C3H5BrO2 |
2-(Dimethylamino)ethyl Methacrylate (stabilized with MEHQ) 98.5+%, TCI America™
CAS: 2867-47-2 Molecular Formula: C8H15NO2 Molecular Weight (g/mol): 157.213 MDL Number: MFCD00008589 InChI Key: JKNCOURZONDCGV-UHFFFAOYSA-N Synonym: 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate PubChem CID: 17869 IUPAC Name: 2-(dimethylamino)ethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCN(C)C
| PubChem CID | 17869 |
|---|---|
| CAS | 2867-47-2 |
| Molecular Weight (g/mol) | 157.213 |
| MDL Number | MFCD00008589 |
| SMILES | CC(=C)C(=O)OCCN(C)C |
| Synonym | 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate |
| InChI Key | JKNCOURZONDCGV-UHFFFAOYSA-N |
| Molecular Formula | C8H15NO2 |
Methyl trans-4-(Aminomethyl)cyclohexanecarboxylate Hydrochloride 98.0+%, TCI America™
CAS: 29275-88-5 Molecular Formula: C9H18ClNO2 Molecular Weight (g/mol): 207.698 MDL Number: MFCD00797465 InChI Key: PZPSRTWFJCGJLP-UHFFFAOYSA-N Synonym: trans-4-(Aminomethyl)cyclohexanecarboxylic Acid Methyl Ester Hydrochloride PubChem CID: 12721445 IUPAC Name: methyl 4-(aminomethyl)cyclohexane-1-carboxylate;hydrochloride SMILES: COC(=O)C1CCC(CC1)CN.Cl
| PubChem CID | 12721445 |
|---|---|
| CAS | 29275-88-5 |
| Molecular Weight (g/mol) | 207.698 |
| MDL Number | MFCD00797465 |
| SMILES | COC(=O)C1CCC(CC1)CN.Cl |
| Synonym | trans-4-(Aminomethyl)cyclohexanecarboxylic Acid Methyl Ester Hydrochloride |
| IUPAC Name | methyl 4-(aminomethyl)cyclohexane-1-carboxylate;hydrochloride |
| InChI Key | PZPSRTWFJCGJLP-UHFFFAOYSA-N |
| Molecular Formula | C9H18ClNO2 |
2,4,6-Trihydroxybenzoic Acid Monohydrate 98.0+%, TCI America™
CAS: 71989-93-0 Molecular Formula: C7H8O6 Molecular Weight (g/mol): 188.135 MDL Number: MFCD00149095 InChI Key: HWZIRFCGHAROOI-UHFFFAOYSA-N Synonym: 2,4,6-trihydroxybenzoic acid hydrate,2,4,6-trihydroxybenzoic acid monohydrate,benzoic acid, 2,4,6-trihydroxy-, monohydrate,phloroglucinolcarboxylic acid,pubchem20337,acmc-209olb,2,4,6-trihydroxybenzoicacidmonohydrate,2,4,6-trihydroxybenzoic acid, hydrate,2,4,6-trihydroxybenzoic acid monohydrate, technical t,2,4,6-trihydroxybenzoic acid monohydrate, technical grade, predominantly 1,3,5-benzenetriol PubChem CID: 2723793 IUPAC Name: 2,4,6-trihydroxybenzoic acid;hydrate SMILES: C1=C(C=C(C(=C1O)C(=O)O)O)O.O
| PubChem CID | 2723793 |
|---|---|
| CAS | 71989-93-0 |
| Molecular Weight (g/mol) | 188.135 |
| MDL Number | MFCD00149095 |
| SMILES | C1=C(C=C(C(=C1O)C(=O)O)O)O.O |
| Synonym | 2,4,6-trihydroxybenzoic acid hydrate,2,4,6-trihydroxybenzoic acid monohydrate,benzoic acid, 2,4,6-trihydroxy-, monohydrate,phloroglucinolcarboxylic acid,pubchem20337,acmc-209olb,2,4,6-trihydroxybenzoicacidmonohydrate,2,4,6-trihydroxybenzoic acid, hydrate,2,4,6-trihydroxybenzoic acid monohydrate, technical t,2,4,6-trihydroxybenzoic acid monohydrate, technical grade, predominantly 1,3,5-benzenetriol |
| IUPAC Name | 2,4,6-trihydroxybenzoic acid;hydrate |
| InChI Key | HWZIRFCGHAROOI-UHFFFAOYSA-N |
| Molecular Formula | C7H8O6 |
S-Propyl Thioacetate 98.0+%, TCI America™
CAS: 2307-10-0 Molecular Formula: C5H10OS Molecular Weight (g/mol): 118.19 MDL Number: MFCD00039937 InChI Key: SBWFWBJCYMBZEY-UHFFFAOYSA-N Synonym: s-propyl thioacetate,propyl thioacetate,ethanethioic acid, s-propyl ester,propyl thiolacetate,s-n-propyl thioacetate,acetic acid, thio-, s-propyl ester,unii-y7284nz6ep,1-propylsulfanyl ethanone,n-propyl thio acetate,fema no. 3385 PubChem CID: 61295 IUPAC Name: 1-(propylsulfanyl)ethan-1-one SMILES: CCCSC(C)=O
| PubChem CID | 61295 |
|---|---|
| CAS | 2307-10-0 |
| Molecular Weight (g/mol) | 118.19 |
| MDL Number | MFCD00039937 |
| SMILES | CCCSC(C)=O |
| Synonym | s-propyl thioacetate,propyl thioacetate,ethanethioic acid, s-propyl ester,propyl thiolacetate,s-n-propyl thioacetate,acetic acid, thio-, s-propyl ester,unii-y7284nz6ep,1-propylsulfanyl ethanone,n-propyl thio acetate,fema no. 3385 |
| IUPAC Name | 1-(propylsulfanyl)ethan-1-one |
| InChI Key | SBWFWBJCYMBZEY-UHFFFAOYSA-N |
| Molecular Formula | C5H10OS |
S-Potassium Thioacetate 97.0+%, TCI America™
CAS: 10387-40-3 Molecular Formula: C2H4KOS Molecular Weight (g/mol): 115.211 MDL Number: MFCD00083065 InChI Key: SDJHDRMYZQFJJO-UHFFFAOYSA-N Synonym: potassium thioacetate,ethanethioic s-acid; potassium,schiff reagent potassium PubChem CID: 24201352 IUPAC Name: ethanethioic S-acid;potassium SMILES: CC(=O)S.[K]
| PubChem CID | 24201352 |
|---|---|
| CAS | 10387-40-3 |
| Molecular Weight (g/mol) | 115.211 |
| MDL Number | MFCD00083065 |
| SMILES | CC(=O)S.[K] |
| Synonym | potassium thioacetate,ethanethioic s-acid; potassium,schiff reagent potassium |
| IUPAC Name | ethanethioic S-acid;potassium |
| InChI Key | SDJHDRMYZQFJJO-UHFFFAOYSA-N |
| Molecular Formula | C2H4KOS |
S-Methyl Thioacetate 95.0+%, TCI America™
CAS: 1534-08-3 Molecular Formula: C3H6OS Molecular Weight (g/mol): 90.14 MDL Number: MFCD00014989 InChI Key: OATSQCXMYKYFQO-UHFFFAOYSA-N Synonym: s-methyl thioacetate,methylthioacetate,ethanethioic acid, s-methyl ester,methanethiol acetate,thioacetic acid s-methyl ester,methyl thiolacetate,methyl ethanethioate,unii-pf2d4mwx79,ch3c o sch3,acetic acid, thio-, s-methyl ester PubChem CID: 73750 ChEBI: CHEBI:51280 IUPAC Name: S-methyl ethanethioate SMILES: CC(=O)SC
| PubChem CID | 73750 |
|---|---|
| CAS | 1534-08-3 |
| Molecular Weight (g/mol) | 90.14 |
| ChEBI | CHEBI:51280 |
| MDL Number | MFCD00014989 |
| SMILES | CC(=O)SC |
| Synonym | s-methyl thioacetate,methylthioacetate,ethanethioic acid, s-methyl ester,methanethiol acetate,thioacetic acid s-methyl ester,methyl thiolacetate,methyl ethanethioate,unii-pf2d4mwx79,ch3c o sch3,acetic acid, thio-, s-methyl ester |
| IUPAC Name | S-methyl ethanethioate |
| InChI Key | OATSQCXMYKYFQO-UHFFFAOYSA-N |
| Molecular Formula | C3H6OS |