Organic carbonic acids and derivatives
eMolecules 2050-94-4 | Dipentyl carbonate | Combi-Blocks, Inc. | MFCD00068969 | 202.294 | C11H22O3 | 98.000 | CCCCCOC(=O)OCCCCC | 25g | 794199473
Dipentyl carbonate | Combi-Blocks, Inc. | 2050-94-4 | MFCD00068969 | 202.294 | C11H22O3 | 98.000 | CCCCCOC(=O)OCCCCC | 25g | 794199473
Accela Chembio Inc MF: C4H6O3 | MW: 102.09 | ?97% | BP: 241.7 celsius at 760 mmHg.
MF: C4H6O3 | MW: 102.09 | ?97% | BP: 241.7 celsius at 760 mmHg.
Sigma Aldrich Fine Chemicals Biosciences Propylene carbonate anhydrous, 99.7% | 108-32-7 | MFCD00005385 | 500ML
Propylene carbonate anhydrous, 99.7% | Purity: 99.7% | Mol Wt: 102.09 | 108-32-7 | MFCD00005385 | 500ML
eMolecules 2050-94-4 | Dipentyl carbonate | Synthonix | MFCD00068969 | 202.294 | C11H22O3 | 95.000 | CCCCCOC(=O)OCCCCC | 100mg | 649433866
Dipentyl carbonate | Synthonix | 2050-94-4 | MFCD00068969 | 202.294 | C11H22O3 | 95.000 | CCCCCOC(=O)OCCCCC | 100mg | 649433866
eMolecules 1044148-88-0 | Imidodicarbonic acid, 2-(2,6-dichloro-4-pyridinyl)-, 1,3-bis(1,1-dimethylethyl) ester | ChemScene363.240 | C15H20Cl2N2O4 | 95.000 | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cc(Cl)nc(Cl)c1 | 100mg | 569146999
Imidodicarbonic acid, 2-(2,6-dichloro-4-pyridinyl)-, 1,3-bis(1,1-dimethylethyl) ester | ChemScene | 1044148-88-0363.240 | C15H20Cl2N2O4 | 95.000 | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cc(Cl)nc(Cl)c1 | 100mg | 569146999
eMolecules 5070-13-3 | 4-Nitrophenyl carbonate | Chem-Impex | MFCD00007322 | 304.214 | C13H8N2O7 | 98.000 | [O-][N+](=O)c1ccc(OC(=O)Oc2ccc(cc2)[N+]([O-])=O)cc1 | 1kg | 112452708
4-Nitrophenyl carbonate | Chem-Impex | 5070-13-3 | MFCD00007322 | 304.214 | C13H8N2O7 | 98.000 | [O-][N+](=O)c1ccc(OC(=O)Oc2ccc(cc2)[N+]([O-])=O)cc1 | 1kg | 112452708
eMolecules 5735-97-7 | ChemScene | 2-(2-Methyl-13-dioxolan-2-yl)acetic acid | 100mg | 572278278 | CS-0060072 | MFCD05625817 | 146.142 | C6H10O4
ChemScene | 2-(2-Methyl-13-dioxolan-2-yl)acetic acid | 100mg | 572278278 | CS-0060072 | 5735-97-7 | MFCD05625817 | 146.142 | C6H10O4
eMolecules 2050-94-4 | Ambeed | Dipentyl carbonate | 100mg | 525128711 | A214148 | MFCD00068969 | 202.294 | C11H22O3
Ambeed | Potassium trifluoro(4-formylphenyl)borate | 1g | 588343437 | A890673 | 374564-36-0 | MFCD02093980 | 212.020 | C7H5BF3KO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 1393822-99-5 | Lithium (6-(1,3-dioxolan-2-yl)pyridin-2-yl)trihydroxyborate | Combi-Blocks | MFCD18070965 | 218.930 | C8H11BLiNO5 | 95.000 | [Li+].O[B-](O)(O)c1cccc(n1)C1OCCO1 | 1g | 267160933](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502192186.JPG-250.jpg)
eMolecules 1393822-99-5 | Lithium (6-(1,3-dioxolan-2-yl)pyridin-2-yl)trihydroxyborate | Combi-Blocks | MFCD18070965 | 218.930 | C8H11BLiNO5 | 95.000 | [Li+].O[B-](O)(O)c1cccc(n1)C1OCCO1 | 1g | 267160933
Lithium (6-(1,3-dioxolan-2-yl)pyridin-2-yl)trihydroxyborate | Combi-Blocks | 1393822-99-5 | MFCD18070965 | 218.930 | C8H11BLiNO5 | 95.000 | [Li+].O[B-](O)(O)c1cccc(n1)C1OCCO1 | 1g | 267160933
eMolecules 108-32-7 | Propylene carbonate | Oakwood Chemical | MFCD00005385 | 102.089 | C4H6O3 | 99.000 | CC1COC(=O)O1 | 25g | 537692942
Propylene carbonate | Oakwood Chemical | 108-32-7 | MFCD00005385 | 102.089 | C4H6O3 | 99.000 | CC1COC(=O)O1 | 25g | 537692942
Sigma Aldrich Fine Chemicals Biosciences Propylene Glycol natural U25KG
Propylene Glycol natural U25KG
eMolecules 626-84-6 | Ambeed | Bis(2-methoxyethyl) carbonate | 1g | 783629723 | A1363121 | 178.184 | C7H14O5
Ambeed | Bis(2-methoxyethyl) carbonate | 1g | 783629723 | A1363121 | 626-84-6 | 178.184 | C7H14O5
Medchemexpress LLC Ethylene carbonate-d4 | 362049-63-6 | MFCD01861595 | 99.2% | 92.09 g/mol | C3D4O3 | 100mg
Ethylene carbonate-d4 is the deuterium labeled Ethylene carbonate[1]
Chemscene ChemScene | Diisopropyl carbonate | 5G | CS-W014351 | 0.98 | 6482-34-4| MFCD07779375 | 146.19
ChemScene | Diisopropyl carbonate | 5G | CS-W014351 | 0.98 | 6482-34-4| MFCD07779375 | 146.19