Piperidines
Medchemexpress LLC HY-W012734 100mg Medchemexpress, H-HoPro-OH CAS:3105-95-1 Purity:>98%
Medchemexpress, HY-W012734 100mg H-HoPro-OH CAS:3105-95-1 H-HoPro-OH is a breakdown product of lysine, accumulates in body fluids of infants with generalized genetic peroxisomal disorders, such as Zellweger syndrome, neonatal adrenoleukodystrophy. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
Sigma Aldrich Fine Chemicals Biosciences Racemic Tiagabine Hydrochloride Mixture United States Pharmacopeia (USP) Reference Standard | 109857-71-8 | 25MG
Racemic Tiagabine Hydrochloride Mixture United States Pharmacopeia (USP) Reference Standard | Mol Wt: 412.01 | 109857-71-8 | 25MG
Accela Chembio Inc 1-boc-3-hydroxypiperidine | 25g | 85275-45-2 | MFCD02093938 | 97+% | Shelf Life: 1260 Days | Moisture Sensitive/+4
1-boc-3-hydroxypiperidine | 25g | 85275-45-2 | MFCD02093938 | 97+% | Shelf Life: 1260 Days | Moisture Sensitive/+4
![eMolecules 190446-85-6 | 1-PIPERIDINECARBOXYLIC ACID,4-[(HYDROXYIMINO)METHYL]-,1,1-DIMETHYLETHYL ESTER | AstaTech | MFCD11616948 | 228.292 | C11H20N2O3 | 95.000 | CC(C)(C)OC(=O)N1CCC(CC1)\C=N\O | 1g | 268500283](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502180915.JPG-250.jpg)
eMolecules 190446-85-6 | 1-PIPERIDINECARBOXYLIC ACID,4-[(HYDROXYIMINO)METHYL]-,1,1-DIMETHYLETHYL ESTER | AstaTech | MFCD11616948 | 228.292 | C11H20N2O3 | 95.000 | CC(C)(C)OC(=O)N1CCC(CC1)\C=N\O | 1g | 268500283
1-PIPERIDINECARBOXYLIC ACID,4-[(HYDROXYIMINO)METHYL]-,1,1-DIMETHYLETHYL ESTER | AstaTech | 190446-85-6 | MFCD11616948 | 228.292 | C11H20N2O3 | 95.000 | CC(C)(C)OC(=O)N1CCC(CC1)\C=N\O | 1g | 268500283
eMolecules 301180-04-1 | N-Cbz-3-piperidinecarboxylic acid t-butyl ester | Combi-Blocks | MFCD04038570 | 319.401 | C18H25NO4 | 98.000 | CC(C)(C)OC(=O)C1CCCN(C1)C(=O)OCc1ccccc1 | 1g | 537622785
N-Cbz-3-piperidinecarboxylic acid t-butyl ester | Combi-Blocks | 301180-04-1 | MFCD04038570 | 319.401 | C18H25NO4 | 98.000 | CC(C)(C)OC(=O)C1CCCN(C1)C(=O)OCc1ccccc1 | 1g | 537622785
Sigma Aldrich Fine Chemicals Biosciences BMS-195614 >=97% (HPLC) | 182135-66-6 | MFCD00952209 | 5MG
BMS-195614 >=97% (HPLC) | Purity: >=97% (HPLC) | Mol Wt: 448.51 | 182135-66-6 | MFCD00952209 | 5MG
Accela Chembio Inc N-boc-4-piperidinemethanol | 25g | 123855-51-6 | MFCD02094488 | 95+% | Shelf Life: 1260 Days | Light Sensitive
N-boc-4-piperidinemethanol | 25g | 123855-51-6 | MFCD02094488 | 95+% | Shelf Life: 1260 Days | Light Sensitive
eMolecules 84512-08-3 | 4-Piperidine butyric acid hydrochloride | Combi-Blocks | MFCD02684340 | 207.700 | C9H18ClNO2 | 98.000 | Cl.OC(=O)CCCC1CCNCC1 | 25g | 267209540
4-Piperidine butyric acid hydrochloride | Combi-Blocks | 84512-08-3 | MFCD02684340 | 207.700 | C9H18ClNO2 | 98.000 | Cl.OC(=O)CCCC1CCNCC1 | 25g | 267209540
eMolecules 135450-43-0 | 1-(6-HYDROXYMETHYL-PYRIDIN-2-YL)-ETHANONE | MFCD09029472 | 0.1g
ChemScene | Pentanethioamide | 100mg | 686174443 | CS-0248646 | 16536-94-0 | MFCD09803501 | 117.210 | C5H11NS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
C1 | 1g | 480110438](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000164184.jpg-250.jpg)
eMolecules 188111-79-7 | (R)-3-Amino-1-N-BOC-piperidine | Oakwood Chemicals | MFCD03094717 | 200.282 | C10H20N2O2 | 97.000 | CC(C)(C)OC(=O)N1CCC[C@@H](N)C1 | 1g | 480110438
(R)-3-Amino-1-N-BOC-piperidine | Oakwood Chemicals | 188111-79-7 | MFCD03094717 | 200.282 | C10H20N2O2 | 97.000 | CC(C)(C)OC(=O)N1CCC[C@@H](N)C1 | 1g | 480110438
eMolecules 1642156-93-1 | ChemScene | 4-Oxopiperidine-1-carbonitrile | 100mg | 788448714 | CS-0609486 | MFCD20258775 | 124.143 | C6H8N2O
Medchem Express | Procyanidin B3 | 1mg | 523883506 | HY-N2345 | 23567-23-9 | MFCD04039989 | 578.526 | C30H26O12
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 1934939-07-7 | tert-butyl 8-oxo-2-oxa-5-azaspiro[3.5]nonane-5-carboxylate | Synthonix - Stock241.287 | C12H19NO4 | 90.000 | CC(C)(C)OC(=O)N1CCC(=O)CC11COC1 | 1g | 490912112](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502168078.JPG-250.jpg)
eMolecules 1934939-07-7 | tert-butyl 8-oxo-2-oxa-5-azaspiro[3.5]nonane-5-carboxylate | Synthonix - Stock241.287 | C12H19NO4 | 90.000 | CC(C)(C)OC(=O)N1CCC(=O)CC11COC1 | 1g | 490912112
tert-butyl 8-oxo-2-oxa-5-azaspiro[3.5]nonane-5-carboxylate | Synthonix - Stock | 1934939-07-7241.287 | C12H19NO4 | 90.000 | CC(C)(C)OC(=O)N1CCC(=O)CC11COC1 | 1g | 490912112
eMolecules 938458-88-9 | 1-Amino-piperidine-3-carboxylic acid ethyl ester | J&W PharmLab LLC | MFCD09055216 | 172.228 | C8H16N2O2 | 96.000 | CCOC(=O)C1CCCN(N)C1 | 100mg | 773119900
1-Amino-piperidine-3-carboxylic acid ethyl ester | J&W PharmLab LLC | 938458-88-9 | MFCD09055216 | 172.228 | C8H16N2O2 | 96.000 | CCOC(=O)C1CCCN(N)C1 | 100mg | 773119900
Apexbio Technology LLC BMS-345541(free base)(Synonyms: BMS 345541, BMS345541, BMS-345541, IKK Inhibitor III, IKK-1/IKK-2 inhibitor), 5mg, CAS: 445430-58-0.
BMS-345541 (free base CAS 445430-58-0) is a selective inhibitor of I B kinases IKK-1 and IKK-2 central enzymes involved in cytokine-induced NF- B signaling It inhibits IKK-1 and IKK-2 with reported IC50 values of approximately 4 M and 0 3 M respectively In cell-based assays utilizing THP-1 monocytes pretreatment with BMS-345541 decreases cytokine-induced phosphorylation of IKK and suppresses production of inflammatory cytokines including TNF- IL-1 IL-6 and IL-8 Additionally in glioma and melanoma cell lines this compound reduces proliferation and induces apoptotic cell death BMS-345541 serves as a relevant pharmacological tool for studying IKK-NF- B pathway modulation and disease mechanisms involving inflammation or apoptosis
eMolecules 1199773-25-5 | N-t-Butyl 4-(4-bromopyrazol-1-yl)benzenesulfonamide | Combi-Blocks | MFCD13195744 | 358.250 | C13H16BrN3O2S | 98.000 | CC(C)(C)NS(=O)(=O)c1ccc(cc1)-n1cc(Br)cn1 | 1g | 117543105
N-t-Butyl 4-(4-bromopyrazol-1-yl)benzenesulfonamide | Combi-Blocks | 1199773-25-5 | MFCD13195744 | 358.250 | C13H16BrN3O2S | 98.000 | CC(C)(C)NS(=O)(=O)c1ccc(cc1)-n1cc(Br)cn1 | 1g | 117543105