Piperidines
eMolecules 71170-89-3 | N-Cbz-2-piperidinecarboxylic acid t-butyl ester | Combi-Blocks, Inc. | MFCD04038573 | 319.401 | C18H25NO4 | 98.000 | CC(C)(C)OC(=O)C1CCCCN1C(=O)OCc1ccccc1 | 1g | 586079299
N-Cbz-2-piperidinecarboxylic acid t-butyl ester | Combi-Blocks, Inc. | 71170-89-3 | MFCD04038573 | 319.401 | C18H25NO4 | 98.000 | CC(C)(C)OC(=O)C1CCCCN1C(=O)OCc1ccccc1 | 1g | 586079299
=O | 1g | 117555199](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502186251.JPG-250.jpg)
eMolecules 79421-45-7 | 1-(4-Nitrophenyl)-4-piperidinol | Combi-Blocks | MFCD00215518 | 222.244 | C11H14N2O3 | 98.000 | OC1CCN(CC1)c1ccc(cc1)[N+]([O-])=O | 1g | 117555199
1-(4-Nitrophenyl)-4-piperidinol | Combi-Blocks | 79421-45-7 | MFCD00215518 | 222.244 | C11H14N2O3 | 98.000 | OC1CCN(CC1)c1ccc(cc1)[N+]([O-])=O | 1g | 117555199
eMolecules 2379560-96-8 | 1-Methyl-piperidine-4-boronic acid pinacol ester hydrochloride | J & W PharmLab, LLC | MFCD11858365 | 261.600 | C12H25BClNO2 | 96.000 | Cl.CN1CCC(CC1)B1OC(C)(C)C(C)(C)O1 | 5g | 249978160
1-Methyl-piperidine-4-boronic acid pinacol ester hydrochloride | J & W PharmLab, LLC | 2379560-96-8 | MFCD11858365 | 261.600 | C12H25BClNO2 | 96.000 | Cl.CN1CCC(CC1)B1OC(C)(C)C(C)(C)O1 | 5g | 249978160
Medchemexpress LLC HY-B0696A 10mg Medchemexpress, Tiagabine (hydrochloride) CAS:145821-59-6 Purity:>98%
Medchemexpress, HY-B0696A 10mg Tiagabine (hydrochloride) CAS:145821-59-6 Tiagabine hydrochloride is a potent and selective GABA reuptake inhibitor, used as an anticonvulsant agent, with IC50s of 67, 446 and 182 nM for [3H]GABA uptake in Synaptosomes, Neurons and Glia, respectively. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
![eMolecules 1427425-91-9 | 1,1-Dimethyl-2-oxa-8-azaspiro[4.5]decane hydrochloride | MFCD11035932 | 1g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502141098.JPG-250.jpg)
eMolecules 1427425-91-9 | 1,1-Dimethyl-2-oxa-8-azaspiro[4.5]decane hydrochloride | MFCD11035932 | 1g
Medchem Express | Ezurpimtrostat (hydrochloride) | 5mg | 719835956 | HY-137978A | 1914148-73-4 | 459.460 | C25H32Cl2N4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 167423-93-0 | Methyl 1-Boc-piperidine-2-carboxylate | Combi-Blocks | MFCD06795925 | 243.303 | C12H21NO4 | 97.000 | COC(=O)C1CCCCN1C(=O)OC(C)(C)C | 100g | 205388317
Methyl 1-Boc-piperidine-2-carboxylate | Combi-Blocks | 167423-93-0 | MFCD06795925 | 243.303 | C12H21NO4 | 97.000 | COC(=O)C1CCCCN1C(=O)OC(C)(C)C | 100g | 205388317
Accela Chembio Inc Benzyl 4-(bromomethyl)tetrahydro-1(2h)-pyridinecarboxylate | 5g | 159275-17-9 | MFCD02681989 | 97+% | Shelf Life: 2340 Days | +4
Benzyl 4-(bromomethyl)tetrahydro-1(2h)-pyridinecarboxylate | 5g | 159275-17-9 | MFCD02681989 | 97+% | Shelf Life: 2340 Days | +4
eMolecules 756452-70-7 | 4-(4-pyridyl)piperidine-4-carbonitrile | Pharmablock | MFCD20668633 | 187.246 | C11H13N3 | 97.000 | N#CC1(CCNCC1)c1ccncc1 | 1g | 551093854
4-(4-pyridyl)piperidine-4-carbonitrile | Pharmablock | 756452-70-7 | MFCD20668633 | 187.246 | C11H13N3 | 97.000 | N#CC1(CCNCC1)c1ccncc1 | 1g | 551093854
Accela Chembio Inc Ethyl N-boc-3-piperidinecarboxylate | 5g | 130250-54-3 | MFCD04116274 | 97+% | Shelf Life: 1260 Days | Light Sensitive/moisture Sensitive/n2
Ethyl N-boc-3-piperidinecarboxylate | 5g | 130250-54-3 | MFCD04116274 | 97+% | Shelf Life: 1260 Days | Light Sensitive/moisture Sensitive/n2
Medchemexpress LLC HY-135053 5mg Medchemexpress, Autotaxin-IN-3 CAS:2156655-68-2 Purity:>98%
Medchemexpress, HY-135053 5mg Autotaxin-IN-3 CAS:2156655-68-2 Autotaxin-IN-3 is a Autotaxin(ATX) inhibitor with an IC50 of 2.4 nM, compound 33, sourced from patent WO2018212534A1. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
![eMolecules 183786-20-1 | (R)-Ethyl piperidine-2-carboxylate hydrochloride | Combi-Blocks | MFCD17926385 | 193.670 | C8H16ClNO2 | 97.000 | Cl.CCOC(=O)[C@H]1CCCCN1 | 1g | 517031298](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502191544.JPG-250.jpg)
eMolecules 183786-20-1 | (R)-Ethyl piperidine-2-carboxylate hydrochloride | Combi-Blocks | MFCD17926385 | 193.670 | C8H16ClNO2 | 97.000 | Cl.CCOC(=O)[C@H]1CCCCN1 | 1g | 517031298
(R)-Ethyl piperidine-2-carboxylate hydrochloride | Combi-Blocks | 183786-20-1 | MFCD17926385 | 193.670 | C8H16ClNO2 | 97.000 | Cl.CCOC(=O)[C@H]1CCCCN1 | 1g | 517031298
eMolecules 1234490-83-5 | Medchem Express | BMS-986094 | 5mg | 719835890 | HY-13337 | 658.649 | C30H39N6O9P
ChemScene | Boc-Lys-OH | 2g | 791178953 | CS-W007618 | 13734-28-6 | MFCD00038203 | 246.307 | C11H22N2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 479057-79-9 | 4-Chloromethyl-piperidine-1-carboxylic acid tert-butyl ester | Combi-Blocks | MFCD08689676 | 233.740 | C11H20ClNO2 | 97.000 | CC(C)(C)OC(=O)N1CCC(CCl)CC1 | 1g | 290688875
4-Chloromethyl-piperidine-1-carboxylic acid tert-butyl ester | Combi-Blocks | 479057-79-9 | MFCD08689676 | 233.740 | C11H20ClNO2 | 97.000 | CC(C)(C)OC(=O)N1CCC(CCl)CC1 | 1g | 290688875
eMolecules 206446-48-2 | TERT-BUTYL 4-(4-(ETHOXYCARBONYL)PHENYL)PIPERIDINE-1-CARBOXYLATE | AstaTech | MFCD11111395 | 333.428 | C19H27NO4 | 95.000 | CCOC(=O)c1ccc(cc1)C1CCN(CC1)C(=O)OC(C)(C)C | 0.25g | 455937376
TERT-BUTYL 4-(4-(ETHOXYCARBONYL)PHENYL)PIPERIDINE-1-CARBOXYLATE | AstaTech | 206446-48-2 | MFCD11111395 | 333.428 | C19H27NO4 | 95.000 | CCOC(=O)c1ccc(cc1)C1CCN(CC1)C(=O)OC(C)(C)C | 0.25g | 455937376
eMolecules 166953-64-6 | N-Z-4-Bromo-piperidine | Chem-Impex | MFCD02681990 | 298.180 | C13H16BrNO2 | 99.000 | BrC1CCN(CC1)C(=O)OCc1ccccc1 | 1g | 112750972
N-Z-4-Bromo-piperidine | Chem-Impex | 166953-64-6 | MFCD02681990 | 298.180 | C13H16BrNO2 | 99.000 | BrC1CCN(CC1)C(=O)OCc1ccccc1 | 1g | 112750972