Acetylides
eMolecules 1256345-96-6 | 3-Butoxy-5-(trifluoromethoxy)phenylboronic acid | Combi-Blocks | MFCD16036112 | 278.030 | C11H14BF3O4 | 97.000 | CCCCOc1cc(OC(F)(F)F)cc(c1)B(O)O | 1g | 117524581
3-Butoxy-5-(trifluoromethoxy)phenylboronic acid | Combi-Blocks | 1256345-96-6 | MFCD16036112 | 278.030 | C11H14BF3O4 | 97.000 | CCCCOc1cc(OC(F)(F)F)cc(c1)B(O)O | 1g | 117524581
Medchemexpress LLC Propargyl-PEG3-CH2COOH | 1694731-93-5 | 98.0% | 25 MG
Propargyl-PEG3-CH2COOH is a PEG-based PROTAC linker that can be utilized in the synthesis of PROTACs. It functions as a click chemistry reagent, containing an Alkyne group that can participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules possessing Azide groups. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein, exploiting the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
- PEG-based PROTAC linker
- Click chemistry reagent with an alkyne group
- Enables copper-catalyzed azide-alkyne cycloaddition (CuAAc)
- Used in the synthesis of PROTACs
- Exploits the ubiquitin-proteasome system to selectively degrade target proteins
Medchemexpress LLC Propargyl-PEG4-Boc | 1355197-66-8 | 316.39 | 1 G
Propargyl-PEG4-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. It is a click chemistry reagent, containing an Alkyne group that can participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
- PEG-based PROTAC linker
- Used in the synthesis of PROTACs
- Click chemistry reagent
- Contains an Alkyne group
- Can participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups
Medchemexpress LLC Propargyl-PEG1-bromide | 18668-74-1 | MFCD00099299 | 98.0% | 163.01 | C5H7BrO | 1 G
Propargyl-PEG1-bromide is an alkyne-functionalized short polyethylene glycol (PEG) linker bearing a terminal bromide. It is used in bioconjugation and medicinal chemistry to introduce a clickable propargyl handle while providing a reactive leaving group for further substitution, enabling efficient incorporation of a short PEG spacer into synthetic linkers and small-molecule constructs.
- Provides an alkyne (propargyl) handle for click chemistry.
- Contains a terminal bromide for nucleophilic substitution reactions.
- Short PEG1 spacer improves solubility and minimizes steric hindrance.
- Molecular weight ~163.01 g/mol for predictable stoichiometry.
- Suitable for linker synthesis, bioconjugation, and small-molecule modification.
Medchemexpress LLC Propargyl-PEG4-acid | 1415800-32-6 | 97.0% | 25 G
Propargyl-PEG4-acid is a PEG-based PROTAC linker used in the synthesis of BTK-IAP PROTACs, including Ibrutinib-based PROTAC 2 and its analogue PROTAC 3. PROTAC 3 has demonstrated BTK degradation with a DC50 of 200 nM in THP-1 cells. This compound also serves as a click chemistry reagent, featuring an Alkyne group for copper-catalyzed azide-alkyne cycloaddition (CuAAc) with azide-containing molecules. It is intended for research use only.
- PEG-based PROTAC linker
- Utilized in the synthesis of BTK-IAP PROTACs
- Functions as a click chemistry reagent
- Possesses an Alkyne group for copper-catalyzed azide-alkyne cycloaddition with azide-containing molecules
- Demonstrates BTK degradation in THP-1 cells
- Intended for research use only
Medchemexpress LLC Propargyl-PEG3-bromide | 203740-63-0 | 97.7% | 251.12 | 1 G
Propargyl-PEG3-bromide is a PEG-based PROTAC linker utilized in the synthesis of PROTACs. It also functions as a click chemistry reagent, containing an alkyne group capable of undergoing copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules that possess azide groups. PROTACs leverage the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
- Click chemistry
- Alkynes
- PROTAC synthesis
- Disease areas: Cancer, Cancer targeted therapy
- PROTAC linkers
![eMolecules 7758-99-8 | Copper(II) sulfate pentahydrate, ACS reagent | Oakwood Chemicals | MFCD00149681 | 249.680 | CuH10O9S | 98.000 | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O | 2.5kg | 480169046](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000128834.jpg-250.jpg)
eMolecules 7758-99-8 | Copper(II) sulfate pentahydrate, ACS reagent | Oakwood Chemicals | MFCD00149681 | 249.680 | CuH10O9S | 98.000 | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O | 2.5kg | 480169046
Copper(II) sulfate pentahydrate, ACS reagent | Oakwood Chemicals | 7758-99-8 | MFCD00149681 | 249.680 | CuH10O9S | 98.000 | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O | 2.5kg | 480169046
Medchemexpress LLC Propargyl-PEG9-amine | 2093153-98-9 | 97.0% | 25 MG
Propargyl-PEG9-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. It is also a click chemistry reagent containing an Alkyne group, capable of undergoing copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
- PEG-based PROTAC linker
- Used in the synthesis of PROTACs
- Click chemistry reagent
- Contains an alkyne group
- Capable of undergoing copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing azide groups
![eMolecules 7758-99-8 | Copper(II) sulfate pentahydrate | Chem-Impex | MFCD00149681 | 249.680 | CuH10O9S | 99.000 | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O | 2.5kg | 603112431](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000127294.jpg-250.jpg)
eMolecules 7758-99-8 | Copper(II) sulfate pentahydrate | Chem-Impex | MFCD00149681 | 249.680 | CuH10O9S | 99.000 | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O | 2.5kg | 603112431
Copper(II) sulfate pentahydrate | Chem-Impex | 7758-99-8 | MFCD00149681 | 249.680 | CuH10O9S | 99.000 | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O | 2.5kg | 603112431
Accela Chembio Inc MF: C7H5N | MW: 103.12 | >97% | Flash Point: 76 celsius | BP: 90¿C/30mmHg | Density: 1.0190.
MF: C7H5N | MW: 103.12 | >97% | Flash Point: 76 celsius | BP: 90¿C/30mmHg | Density: 1.0190.