Organonitrogen Compounds
Medchemexpress LLC Dimethylamino-PEG3 50mg
Dimethylamino-PEG3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]
eMolecules 504-63-2 | 1,3-Propanediol | Ambeed | MFCD00002949 | 76.095 | C3H8O2 | 99.000 | OCCCO | 100g | 788439581
1,3-Propanediol | Ambeed | 504-63-2 | MFCD00002949 | 76.095 | C3H8O2 | 99.000 | OCCCO | 100g | 788439581
eMolecules 1222533-78-9 | 8-Pivaloyl-5,6,7,8-tetrahydro-1,8-naphthyridine-3-carbonitrile | Combi-Blocks, Inc. | MFCD16628237 | 243.310 | C14H17N3O | 98.000 | CC(C)(C)C(=O)N1CCCc2cc(cnc12)C#N | 1g | 569298174
8-Pivaloyl-5,6,7,8-tetrahydro-1,8-naphthyridine-3-carbonitrile | Combi-Blocks, Inc. | 1222533-78-9 | MFCD16628237 | 243.310 | C14H17N3O | 98.000 | CC(C)(C)C(=O)N1CCCc2cc(cnc12)C#N | 1g | 569298174
eMolecules 5470-34-8 | 4'-Methoxyformanilide | Combi-Blocks | MFCD00086774 | 151.165 | C8H9NO2 | 98.000 | COc1ccc(NC=O)cc1 | 25g | 457915671
4'-Methoxyformanilide | Combi-Blocks | 5470-34-8 | MFCD00086774 | 151.165 | C8H9NO2 | 98.000 | COc1ccc(NC=O)cc1 | 25g | 457915671
eMolecules 2096331-52-9 | 3-Bromo-5-(1-t-BOC-piperidin-4-yl)methoxyphenylboronic acid | Combi-Blocks | MFCD18087693 | 414.100 | C17H25BBrNO5 | 98.000 | CC(C)(C)OC(=O)N1CCC(COc2cc(Br)cc(c2)B(O)O)CC1 | 1g | 117524885
3-Bromo-5-(1-t-BOC-piperidin-4-yl)methoxyphenylboronic acid | Combi-Blocks | 2096331-52-9 | MFCD18087693 | 414.100 | C17H25BBrNO5 | 98.000 | CC(C)(C)OC(=O)N1CCC(COc2cc(Br)cc(c2)B(O)O)CC1 | 1g | 117524885
Medchemexpress LLC Dried aluminum hydro 10mg
Dried aluminum hydroxide gel is a commonly used antacid with significant compound adhesion and release activity Dried aluminum hydroxide gel can effectively neutralize gastric acid and relieve stomach discomfort Dried aluminum hydroxide gel is also often used as an adjuvant in vaccines to enhance immune response Dried aluminum hydroxide gel can improve the stability and bioavailability of compounds in preparations
Medchemexpress LLC Apraclonidine hydrochloride | 73218-79-8 | 99.0% | 1 ML
Apraclonidine hydrochloride is a selective α2 and weak α1 receptor agonist that effectively lowers intraocular pressure in human eyes. It is a topical ophthalmic solution with the ability to elevate the eyelid. Its ocular hypotensive effects are primarily attributed to reduced aqueous humor synthesis and vasoconstrictor actions at the anterior segment branches of the ophthalmic artery.
- Used topically for glaucoma.
- Penetrates the cornea and blood-brain barrier to a lesser extent, resulting in fewer adverse systemic effects.