Other Solvents
Filtered Search Results
n-Heptane-d{16}, 98% (Isotopic)
CAS: 33838-52-7 Molecular Formula: C7H16 Molecular Weight (g/mol): 100.21 MDL Number: MFCD00062744 InChI Key: IMNFDUFMRHMDMM-UHFFFAOYSA-N Synonym: heptane-d16,n-heptane-d 16,2h16 heptane,hexadecadeuterio-heptane,2 h?? heptane,heptane-d16, 99 atom % d PubChem CID: 524600 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecadeuterioheptane SMILES: CCCCCCC
| PubChem CID | 524600 |
|---|---|
| CAS | 33838-52-7 |
| Molecular Weight (g/mol) | 100.21 |
| MDL Number | MFCD00062744 |
| SMILES | CCCCCCC |
| Synonym | heptane-d16,n-heptane-d 16,2h16 heptane,hexadecadeuterio-heptane,2 h?? heptane,heptane-d16, 99 atom % d |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecadeuterioheptane |
| InChI Key | IMNFDUFMRHMDMM-UHFFFAOYSA-N |
| Molecular Formula | C7H16 |
1-Methyl-2-pyrrolidinone, Solstice™
CAS: 872-50-4 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.13 InChI Key: SECXISVLQFMRJM-UHFFFAOYSA-N PubChem CID: 13387 ChEBI: CHEBI:7307 IUPAC Name: 1-methylpyrrolidin-2-one SMILES: CN1CCCC1=O
| PubChem CID | 13387 |
|---|---|
| CAS | 872-50-4 |
| Molecular Weight (g/mol) | 99.13 |
| ChEBI | CHEBI:7307 |
| SMILES | CN1CCCC1=O |
| IUPAC Name | 1-methylpyrrolidin-2-one |
| InChI Key | SECXISVLQFMRJM-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
Formamide, Spectrophotometric Grade, 99+%
CAS: 75-12-7 Molecular Formula: CH3NO Molecular Weight (g/mol): 45.04 MDL Number: MFCD00007941 InChI Key: ZHNUHDYFZUAESO-UHFFFAOYSA-N Synonym: methanamide,carbamaldehyde,formimidic acid,formic acid, amide,formamid,methanoic acid, amide,amid kyseliny mravenci,amid kyseliny mravenci czech,formic amide,hsdb 88 PubChem CID: 713 ChEBI: CHEBI:48431 IUPAC Name: formamide SMILES: NC=O
| PubChem CID | 713 |
|---|---|
| CAS | 75-12-7 |
| Molecular Weight (g/mol) | 45.04 |
| ChEBI | CHEBI:48431 |
| MDL Number | MFCD00007941 |
| SMILES | NC=O |
| Synonym | methanamide,carbamaldehyde,formimidic acid,formic acid, amide,formamid,methanoic acid, amide,amid kyseliny mravenci,amid kyseliny mravenci czech,formic amide,hsdb 88 |
| IUPAC Name | formamide |
| InChI Key | ZHNUHDYFZUAESO-UHFFFAOYSA-N |
| Molecular Formula | CH3NO |
Pyridine-d{5}, 99.5% (Isotopic)
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |
2,2,4-Trimethylpentane, 95.0%, MilliporeSigma™
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.23 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| CAS | 540-84-1 |
|---|---|
| Molecular Weight (g/mol) | 114.23 |
| SMILES | CC(C)CC(C)(C)C |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
Naphthalene-d8, for NMR, 98+ atom % D
CAS: 1146-65-2 Molecular Formula: C10H8 Molecular Weight (g/mol): 136.22 MDL Number: MFCD00001743 InChI Key: UFWIBTONFRDIAS-PGRXLJNUSA-N Synonym: naphthalene-d8,2h8 naphthalene,perdeuteronaphthalene,naphthalene d8,perdeuterated naphthalene,2 h? naphthalene,naphthalene-d8, analytical standard,naphthalene-d8 >98.0 atom % d,naphthalene d8 10 microg/ml in cyclohexane PubChem CID: 92148 IUPAC Name: 1,2,3,4,5,6,7,8-octadeuterionaphthalene SMILES: [2H]C1=C([2H])C2=C([2H])C([2H])=C([2H])C([2H])=C2C([2H])=C1[2H]
| PubChem CID | 92148 |
|---|---|
| CAS | 1146-65-2 |
| Molecular Weight (g/mol) | 136.22 |
| MDL Number | MFCD00001743 |
| SMILES | [2H]C1=C([2H])C2=C([2H])C([2H])=C([2H])C([2H])=C2C([2H])=C1[2H] |
| Synonym | naphthalene-d8,2h8 naphthalene,perdeuteronaphthalene,naphthalene d8,perdeuterated naphthalene,2 h? naphthalene,naphthalene-d8, analytical standard,naphthalene-d8 >98.0 atom % d,naphthalene d8 10 microg/ml in cyclohexane |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterionaphthalene |
| InChI Key | UFWIBTONFRDIAS-PGRXLJNUSA-N |
| Molecular Formula | C10H8 |
Ecolite(+) LC Fluid, MP Biomedicals
Liquid Scintillation Cocktails; Ecolite(+); MP Biomedical; Biodegradable
| Chemical Name or Material | Liquid Scintillation Cocktails |
|---|
Deuterosulfuric acid, 96% min in D{2}O, 99.5% (Isotopic)
CAS: 13813-19-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 100.08 MDL Number: MFCD00003542 InChI Key: QAOWNCQODCNURD-ZSJDYOACSA-N Synonym: sulfuric acid-d2,deuterosulfuric acid,dideuterosulfuric acid,sulphuric 2h2 acid,sulfuric acid-d2 solution,d2so4,dideuterosulfuric acid solution,2 h? sulfuric acid,sulfuric acid-d2, 98 wt% in deuterium oxide,deuterosulfuric acid min in d 2 o isotopic PubChem CID: 160992 IUPAC Name: dideuterio sulfate SMILES: [2H]OS(=O)(=O)O[2H]
| PubChem CID | 160992 |
|---|---|
| CAS | 13813-19-9 |
| Molecular Weight (g/mol) | 100.08 |
| MDL Number | MFCD00003542 |
| SMILES | [2H]OS(=O)(=O)O[2H] |
| Synonym | sulfuric acid-d2,deuterosulfuric acid,dideuterosulfuric acid,sulphuric 2h2 acid,sulfuric acid-d2 solution,d2so4,dideuterosulfuric acid solution,2 h? sulfuric acid,sulfuric acid-d2, 98 wt% in deuterium oxide,deuterosulfuric acid min in d 2 o isotopic |
| IUPAC Name | dideuterio sulfate |
| InChI Key | QAOWNCQODCNURD-ZSJDYOACSA-N |
| Molecular Formula | H2O4S |
Acetic anhydride-d6, for NMR, 98.5 atom % D
CAS: 16649-49-3 Molecular Formula: C4H6O3 Molecular Weight (g/mol): 108.13 MDL Number: MFCD00044225 InChI Key: WFDIJRYMOXRFFG-WFGJKAKNSA-N Synonym: acetic anhydride-d6,2h3 acetic anhydride,acetic anhydride d6,2h3 acetyl 2h3 acetate,acetic anhydride-d6, 99 atom % d,2 h? acetyl 2 h? acetate,2,2,2-trideuterioacetyl 2,2,2-trideuterioacetate PubChem CID: 2723966 IUPAC Name: (2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate SMILES: [2H]C([2H])([2H])C(=O)OC(=O)C([2H])([2H])[2H]
| PubChem CID | 2723966 |
|---|---|
| CAS | 16649-49-3 |
| Molecular Weight (g/mol) | 108.13 |
| MDL Number | MFCD00044225 |
| SMILES | [2H]C([2H])([2H])C(=O)OC(=O)C([2H])([2H])[2H] |
| Synonym | acetic anhydride-d6,2h3 acetic anhydride,acetic anhydride d6,2h3 acetyl 2h3 acetate,acetic anhydride-d6, 99 atom % d,2 h? acetyl 2 h? acetate,2,2,2-trideuterioacetyl 2,2,2-trideuterioacetate |
| IUPAC Name | (2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate |
| InChI Key | WFDIJRYMOXRFFG-WFGJKAKNSA-N |
| Molecular Formula | C4H6O3 |
n-Hexane-d14, for NMR, 99+ atom % D
CAS: 21666-38-6 Molecular Formula: C6H14 Molecular Weight (g/mol): 100.26 MDL Number: MFCD00037562 InChI Key: VLKZOEOYAKHREP-ZLKPZJALSA-N Synonym: hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d PubChem CID: 140854 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
| PubChem CID | 140854 |
|---|---|
| CAS | 21666-38-6 |
| Molecular Weight (g/mol) | 100.26 |
| MDL Number | MFCD00037562 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Synonym | hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane |
| InChI Key | VLKZOEOYAKHREP-ZLKPZJALSA-N |
| Molecular Formula | C6H14 |
3-chloro-4-methylphenylboronic acid, 97%, Thermo Scientific Chemicals
CAS: 175883-63-3 Molecular Formula: C7H8BClO2 Molecular Weight (g/mol): 170.40 MDL Number: MFCD04039010 InChI Key: YTJUYWRCAZWVSX-UHFFFAOYSA-N Synonym: 3-chloro-4-methylphenyl boronic acid,3-chloro-4-methylbenzeneboronic acid,3-chloro-4-methylphenylboronicacid,3-chloro-p-tolylboronic acid,boronic acid, 3-chloro-4-methylphenyl,pubchem5132,3-chloro-4-methyl-phenyl boronic acid,acmc-209eaq,ksc489k9f,3-chloro-4-methylphenyl-boronic acid PubChem CID: 3854610 IUPAC Name: (3-chloro-4-methylphenyl)boronic acid SMILES: CC1=CC=C(C=C1Cl)B(O)O
| PubChem CID | 3854610 |
|---|---|
| CAS | 175883-63-3 |
| Molecular Weight (g/mol) | 170.40 |
| MDL Number | MFCD04039010 |
| SMILES | CC1=CC=C(C=C1Cl)B(O)O |
| Synonym | 3-chloro-4-methylphenyl boronic acid,3-chloro-4-methylbenzeneboronic acid,3-chloro-4-methylphenylboronicacid,3-chloro-p-tolylboronic acid,boronic acid, 3-chloro-4-methylphenyl,pubchem5132,3-chloro-4-methyl-phenyl boronic acid,acmc-209eaq,ksc489k9f,3-chloro-4-methylphenyl-boronic acid |
| IUPAC Name | (3-chloro-4-methylphenyl)boronic acid |
| InChI Key | YTJUYWRCAZWVSX-UHFFFAOYSA-N |
| Molecular Formula | C7H8BClO2 |
4-Chlorophenoxyacetic acid, 98%
CAS: 122-88-3 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.59 MDL Number: MFCD00004305 InChI Key: SODPIMGUZLOIPE-UHFFFAOYSA-N Synonym: 4-chlorophenoxyacetic acid,2-4-chlorophenoxy acetic acid,4-chlorophenoxy acetic acid,4-cpa,sure-set,tomatotone,tomato fix,acetic acid, 4-chlorophenoxy,p-chlorophenoxyacetic acid,tomato hold PubChem CID: 26229 ChEBI: CHEBI:1808 IUPAC Name: 2-(4-chlorophenoxy)acetic acid SMILES: C1=CC(=CC=C1OCC(=O)O)Cl
| PubChem CID | 26229 |
|---|---|
| CAS | 122-88-3 |
| Molecular Weight (g/mol) | 186.59 |
| ChEBI | CHEBI:1808 |
| MDL Number | MFCD00004305 |
| SMILES | C1=CC(=CC=C1OCC(=O)O)Cl |
| Synonym | 4-chlorophenoxyacetic acid,2-4-chlorophenoxy acetic acid,4-chlorophenoxy acetic acid,4-cpa,sure-set,tomatotone,tomato fix,acetic acid, 4-chlorophenoxy,p-chlorophenoxyacetic acid,tomato hold |
| IUPAC Name | 2-(4-chlorophenoxy)acetic acid |
| InChI Key | SODPIMGUZLOIPE-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO3 |
4-Chloro-2-fluoroaniline, 98%
CAS: 57946-56-2 Molecular Formula: C6H5ClFN Molecular Weight (g/mol): 145.56 MDL Number: MFCD00010625 InChI Key: CSFDTBRRIBJILD-UHFFFAOYSA-N Synonym: 2-fluoro-4-chloroaniline,4-chloro-2-fluorobenzenamine,4-chloro-2-fluoro-phenylamine,benzenamine, 4-chloro-2-fluoro,4-chloro-2-fluoro-aniline,4-chloro-2-fluorophenylamine,pubchem1514,4-chloro-2fluoroaniline,4chloro-2-fluoroaniline,acmc-1at8a PubChem CID: 93898 IUPAC Name: 4-chloro-2-fluoroaniline SMILES: NC1=CC=C(Cl)C=C1F
| PubChem CID | 93898 |
|---|---|
| CAS | 57946-56-2 |
| Molecular Weight (g/mol) | 145.56 |
| MDL Number | MFCD00010625 |
| SMILES | NC1=CC=C(Cl)C=C1F |
| Synonym | 2-fluoro-4-chloroaniline,4-chloro-2-fluorobenzenamine,4-chloro-2-fluoro-phenylamine,benzenamine, 4-chloro-2-fluoro,4-chloro-2-fluoro-aniline,4-chloro-2-fluorophenylamine,pubchem1514,4-chloro-2fluoroaniline,4chloro-2-fluoroaniline,acmc-1at8a |
| IUPAC Name | 4-chloro-2-fluoroaniline |
| InChI Key | CSFDTBRRIBJILD-UHFFFAOYSA-N |
| Molecular Formula | C6H5ClFN |
1,2,4,5-Tetrachlorobenzene, 98%
CAS: 95-94-3 Molecular Formula: C6H2Cl4 Molecular Weight (g/mol): 215.89 MDL Number: MFCD00000549 InChI Key: JHBKHLUZVFWLAG-UHFFFAOYSA-N Synonym: s-tetrachlorobenzene,benzene, 1,2,4,5-tetrachloro,benzene tetrachloride,rcra waste number u207,1,2,4,5-tetrachlorbenzol,unii-5n27529kgh,ccris 766,benzene, tetrachloro,rcra waste no. u207,1,2,4,5-tetrachlorbenzol russian PubChem CID: 7270 ChEBI: CHEBI:36697 IUPAC Name: 1,2,4,5-tetrachlorobenzene SMILES: C1=C(C(=CC(=C1Cl)Cl)Cl)Cl
| PubChem CID | 7270 |
|---|---|
| CAS | 95-94-3 |
| Molecular Weight (g/mol) | 215.89 |
| ChEBI | CHEBI:36697 |
| MDL Number | MFCD00000549 |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)Cl |
| Synonym | s-tetrachlorobenzene,benzene, 1,2,4,5-tetrachloro,benzene tetrachloride,rcra waste number u207,1,2,4,5-tetrachlorbenzol,unii-5n27529kgh,ccris 766,benzene, tetrachloro,rcra waste no. u207,1,2,4,5-tetrachlorbenzol russian |
| IUPAC Name | 1,2,4,5-tetrachlorobenzene |
| InChI Key | JHBKHLUZVFWLAG-UHFFFAOYSA-N |
| Molecular Formula | C6H2Cl4 |
EcoLume Scintillation Cocktail, MP Biomedicals
Greener Choice
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
| Chemical Name or Material | EcoLume™ Liquid Scintillation Cocktail |
|---|