Organic phosphoric acids and derivatives
Alkali Scientific Sodium Phosphate Dibasic, Anhydrous, 5 Kg
Sodium Phosphate Dibasic, Anhydrous, 5 Kg is a highly concentrated reagent commonly used to prepare phosphate buffer solutions for laboratory research and applications. The anhydrous form of sodium phosphate dibasic ensures accurate preparation of buffer solutions without the risk of water contamination, which can alter the final concentrations. This reagent is widely used in areas such as chromatography, enzyme assays, molecular biology, and pharmaceutical testing. The 5 Kg quantity is suitable for high-demand laboratories, allowing for efficient buffer preparation for large-scale experiments. It is also a key component in the formulation of many laboratory reagents and chemical processes where pH stability is critical.
eMolecules 108549-23-1 | Dibenzyl N,N-diisopropylphosphoramidite | Ambeed | MFCD00191988 | 345.423 | C20H28NO2P | 95.000 | CC(C)N(C(C)C)P(OCc1ccccc1)OCc1ccccc1 | 25g | 525096746
Dibenzyl N,N-diisopropylphosphoramidite | Ambeed | 108549-23-1 | MFCD00191988 | 345.423 | C20H28NO2P | 95.000 | CC(C)N(C(C)C)P(OCc1ccccc1)OCc1ccccc1 | 25g | 525096746