Acetylides
Medchemexpress LLC Propargyl-PEG6-NH2 | 1198080-04-4 | 99.7% | 5 G
Propargyl-PEG6-NH2 is a PEG-based PROTAC linker that functions as a click chemistry reagent. It contains an Alkyne group, enabling it to undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules possessing Azide groups. This reagent is primarily used in the synthesis of PROTACs, which leverage the intracellular ubiquitin-proteasome system for selective degradation of target proteins.
- PEG-based PROTAC linker
- Utilized in the synthesis of PROTACs
- Functions as a click chemistry reagent
- Contains an Alkyne group
- Engages in copper-catalyzed azide-alkyne cycloaddition (CuAAc)
- Reacts with molecules possessing Azide groups
Medchemexpress LLC Propargyl-PEG4-Boc | 1355197-66-8 | 316.39 | 250 MG
Propargyl-PEG4-Boc is a PEG-based PROTAC linker designed for the synthesis of PROTACs. It functions as a click chemistry reagent, featuring an Alkyne group that readily undergoes copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. This reagent facilitates the creation of PROTACs, which are compounds that exploit the ubiquitin-proteasome system to degrade target proteins.
- PEG-based PROTAC linker
- Click chemistry reagent
- Contains an Alkyne group for CuAAc reactions
- Used in the synthesis of PROTACs
Medchemexpress LLC Propargyl-peg3-bromide | 203740-63-0 | 97.66% | 251.12 | 100 MG
Propargyl-PEG3-bromide is a PEG-based PROTAC linker used in the synthesis of PROTACs. It is also a click chemistry reagent containing an Alkyne group that can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
- Peg-based protac linker
- Used in the synthesis of protacs
- Click chemistry reagent
- Contains an alkyne group
- Undergoes copper-catalyzed azide-alkyne cycloaddition (Cuaac)
- Reacts with molecules containing azide groups
eMolecules 86256-18-0 | 4-Fluoro-3-(trifluoromethoxy)benzyl alcohol | Apollo Scientific | MFCD06660255 | 210.128 | C8H6F4O2 | 98.000 | OCc1ccc(F)c(OC(F)(F)F)c1 | 1g | 562452484
4-Fluoro-3-(trifluoromethoxy)benzyl alcohol | Apollo Scientific | 86256-18-0 | MFCD06660255 | 210.128 | C8H6F4O2 | 98.000 | OCc1ccc(F)c(OC(F)(F)F)c1 | 1g | 562452484
eMolecules 886501-26-4 | 4-Fluoro-3-(trifluoromethoxy)phenol | Apollo Scientific | MFCD06660257 | 196.101 | C7H4F4O2 | 95.000 | Oc1ccc(F)c(OC(F)(F)F)c1 | 1g | 562453217
4-Fluoro-3-(trifluoromethoxy)phenol | Apollo Scientific | 886501-26-4 | MFCD06660257 | 196.101 | C7H4F4O2 | 95.000 | Oc1ccc(F)c(OC(F)(F)F)c1 | 1g | 562453217
Medchemexpress LLC Propargyl-PEG3-methane | 89635-82-5 | MFCD27977518 | 98.0% | 202.25 | 500 MG
Propargyl-PEG3-methane is a PEG-based PROTAC linker, designed for use in the synthesis of Proteolysis Targeting Chimeras (PROTACs). It functions as a versatile click chemistry reagent, facilitating various bioconjugation and labeling applications.
- PEG-based PROTAC linker
- Utilized in the synthesis of PROTACs
- Functions as a click chemistry reagent
- Facilitates bioconjugation and labeling
Aobchem 1-Bromo-3 3-diethoxy-1-propyne | 95% | CAS 18344-15-5 | C7H11BrO2 | 500mg
1-Bromo-3 3-diethoxy-1-propyne | 95% | CAS 18344-15-5 | C7H11BrO2 | 500mg
Aobchem 1-Bromo-3 3-diethoxy-1-propyne | 95% | CAS 18344-15-5 | C7H11BrO2 | 250mg
1-Bromo-3 3-diethoxy-1-propyne | 95% | CAS 18344-15-5 | C7H11BrO2 | 250mg
Aobchem 2-(4-Chlorophenyl)pent-4-enenitrile | 95% | CAS 494802-78-7 | C11H10ClN | 1g
2-(4-Chlorophenyl)pent-4-enenitrile | 95% | CAS 494802-78-7 | C11H10ClN | 1g
Selegiline Hydrochloride, USP, 98-101%, Spectrum™ Chemical
CAS: 14611-52-0 Molecular Formula: C13H18ClN Molecular Weight (g/mol): 223.74 MDL Number: MFCD00069299 InChI Key: IYETZZCWLLUHIJ-UTONKHPSSA-N IUPAC Name: hydrogen methyl[(2R)-1-phenylpropan-2-yl](prop-2-yn-1-yl)amine chloride SMILES: [H+].[Cl-].C[C@H](CC1=CC=CC=C1)N(C)CC#C
MP Biomedicals, Inc 1-Hexyn-3-ol, MP Biomedicals
CAS: 105-31-7 Molecular Formula: C6H10O Molecular Weight (g/mol): 98.145 InChI Key: LTFTWJYRQNTCHI-UHFFFAOYSA-N Synonym: 1-hexyn-3-ol,propylethinylcarbinol,1-hexyne-3-ol,3-hydroxy-1-hexyne,1-propylpropargyl alcohol,1-hexine-3-ol,acmc-2098fm,dsstox_cid_30088,dsstox_gsid_51536,4-01-00-02234 beilstein handbook reference PubChem CID: 7746 IUPAC Name: hex-1-yn-3-ol SMILES: CCCC(C#C)O
1,1-Diethylpropargylamine, 97%, Thermo Scientific™
CAS: 3234-64-8 Molecular Formula: C7H14N Molecular Weight (g/mol): 112.20 MDL Number: MFCD00008057 InChI Key: WHNOKDNCUNZBLW-UHFFFAOYSA-O Synonym: 1,1-diethylpropargylamine,1-pentyn-3-amine, 3-ethyl,1-pentyn-3-amine,3-ethyl,1,1-diethyl-prop-2-ynylamine,2,2-diethylpropargylamine,1,1-diethylproparagyl amine,3-ethyl-1-pentyn-3-amine,3-amino-3-ethyl-1-pentyne,1,1-diethyl-2-propynylamine,1,1-diethyl-2-propynylamine # PubChem CID: 76710 IUPAC Name: 3-ethylpent-1-yn-3-aminium SMILES: CCC([NH3+])(CC)C#C
N-Propargyloxyphthalimide, 97%, Thermo Scientific™
CAS: 4616-63-1 Molecular Formula: C11H7NO3 Molecular Weight (g/mol): 201.181 MDL Number: MFCD00005890 InChI Key: HBGZBVPXPDNXOV-UHFFFAOYSA-N Synonym: n-propargyloxy phthalimide,n-prop-2-ynyloxy phthalimide,2-prop-2-yn-1-yloxy isoindoline-1,3-dione,n-propargyloxyphthalimide,2-prop-2-yn-1-yloxy isoindole-1,3-dione,2-prop-2-ynyloxybenzo c azoline-1,3-dione,acmc-20aka8,n-2-propynoxyphthalimide,n-2-propynyloxy phthalimide,phthalimide, n-2-propynyloxy PubChem CID: 78357 IUPAC Name: 2-prop-2-ynoxyisoindole-1,3-dione SMILES: C#CCON1C(=O)C2=CC=CC=C2C1=O
1,6-Heptadiyne, Thermo Scientific™
CAS: 2396-63-6 Molecular Formula: C7H8 Molecular Weight (g/mol): 92.141 MDL Number: MFCD00014925 InChI Key: RSPZSDWVQWRAEF-UHFFFAOYSA-N Synonym: 1,6-heptadiyne,1,6-heptadiyne 6ci, 8ci, 9ci,heptane-1,6-diyne,acmc-1cin6,1,6-heptadiyne, 97+%,wln: 1uu5uu1,4-01-00-01121 beilstein handbook reference PubChem CID: 337121 IUPAC Name: hepta-1,6-diyne SMILES: C#CCCCC#C