Aminobenzoic acids and derivatives
Chemscene Z-L-Val-OH | 100g | CS-W009469 | 98% | 1149-26-4 | MFCD00008922 | 251 28 | C13H17NO4
Chemscene | Z-L-Val-OH | 100g | CS-W009469 | 98% | 1149-26-4 | MFCD00008922 | 251 28 | C13H17NO4
Chemscene BrettPhos | 1g | CS-W007661 | 98% | 1070663-78-3 | MFCD11973797 | 536 77 | C35H53O2P
Chemscene | BrettPhos | 1g | CS-W007661 | 98% | 1070663-78-3 | MFCD11973797 | 536 77 | C35H53O2P
Medchemexpress LLC 5-Amino-2-chlorobenzotrifluoride | 320-51-4 | 99.9% | C7H5ClF3N | 50 G
5-Amino-2-chlorobenzotrifluoride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. It is noted as an impurity of Sorafenib.
- Small inhibitor of several tyrosine protein kinases
- Treats primary kidney cancer
- Treats advanced primary liver cancer
- Treats radioactive iodine-resistant advanced thyroid carcinoma
Chemscene Ethyl 2-phenylbutanoate | 1g | CS-W015806 | 98% | 119-43-7 | MFCD00068988 | 192 26 | C12H16O2
Chemscene | Ethyl 2-phenylbutanoate | 1g | CS-W015806 | 98% | 119-43-7 | MFCD00068988 | 192 26 | C12H16O2
Chem-Impex International, Inc. FMOC 3 AMINO 1 CARBOXYMETHY 5G
Fmoc-3-amino-1-carboxymethyl-pyridin-2-one, 5g
![eMolecules 83249-10-9 | 3-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acid | Combi-Blocks, Inc. | MFCD20638314 | 170.164 | C8H10O4 | 98.000 | COC(=O)C12CC(C1)(C2)C(O)=O | 100g | 642100646](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000169855.jpg-250.jpg)
eMolecules 83249-10-9 | 3-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acid | Combi-Blocks, Inc. | MFCD20638314 | 170.164 | C8H10O4 | 98.000 | COC(=O)C12CC(C1)(C2)C(O)=O | 100g | 642100646
3-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acid | Combi-Blocks, Inc. | 83249-10-9 | MFCD20638314 | 170.164 | C8H10O4 | 98.000 | COC(=O)C12CC(C1)(C2)C(O)=O | 100g | 642100646
eMolecules 3374-22-9 | H-DL-Cys-OH | Ambeed | MFCD00004881 | 121.150 | C3H7NO2S | 95.000 | NC(CS)C(O)=O | 25g | 490525781
H-DL-Cys-OH | Ambeed | 3374-22-9 | MFCD00004881 | 121.150 | C3H7NO2S | 95.000 | NC(CS)C(O)=O | 25g | 490525781
Chemscene 2 6-Difluoro-4-methoxybenzoic acid | 100g | CS-W016826 | 98% | 123843-65-2 | MFCD02949623 | 188 13 | C8H6F2O3
Chemscene | 2 6-Difluoro-4-methoxybenzoic acid | 100g | CS-W016826 | 98% | 123843-65-2 | MFCD02949623 | 188 13 | C8H6F2O3
Chemscene 5-Methoxynicotinaldehyde | 1g | CS-W003409 | 98% | 113118-83-5 | MFCD07437946 | 137 14 | C7H7NO2
Chemscene | 5-Methoxynicotinaldehyde | 1g | CS-W003409 | 98% | 113118-83-5 | MFCD07437946 | 137 14 | C7H7NO2
Chemscene 2-Phenyloxazol-5(4H)-one | 10g | CS-W017933 | 97% | 1199-01-5 | MFCD00014517 | 161 16 | C9H7NO2
Chemscene | 2-Phenyloxazol-5(4H)-one | 10g | CS-W017933 | 97% | 1199-01-5 | MFCD00014517 | 161 16 | C9H7NO2
Chemscene L-Ethionine | 100mg | CS-W017916 | 98% | 13073-35-3 | MFCD00002626 | 163 24 | C6H13NO2S
Chemscene | L-Ethionine | 100mg | CS-W017916 | 98% | 13073-35-3 | MFCD00002626 | 163 24 | C6H13NO2S
Chemscene DCTA (monohydrate) | 100g | CS-W013894 | 98% | 125572-95-4 | MFCD00149243 | 364 35 | C14H24N2O9
Chemscene | DCTA (monohydrate) | 100g | CS-W013894 | 98% | 125572-95-4 | MFCD00149243 | 364 35 | C14H24N2O9
Chemscene 2-Bromo-4-fluoroaniline | 100g | CS-W018523 | 98% | 1003-98-1 | MFCD00042462 | 190 01 | C6H5BrFN
Chemscene | 2-Bromo-4-fluoroaniline | 100g | CS-W018523 | 98% | 1003-98-1 | MFCD00042462 | 190 01 | C6H5BrFN
Medchemexpress LLC Concanavalin A (Biotinylated) | 1 MG
Concanavalin A (Con A) Biotinylated is a biological material or organic compound that can be used in life science research. This product is for research use only.
- Suitable for life science research
- Functions as a biochemical assay reagent
- Categorized as a native protein
eMolecules 1423-26-3 | 3-(Trifluoromethyl)phenylboronic acid | Chem-Impex | MFCD00151854 | 189.930 | C7H6BF3O2 | 98.000 | OB(O)c1cccc(c1)C(F)(F)F | 100g | 112769480
3-(Trifluoromethyl)phenylboronic acid | Chem-Impex | 1423-26-3 | MFCD00151854 | 189.930 | C7H6BF3O2 | 98.000 | OB(O)c1cccc(c1)C(F)(F)F | 100g | 112769480