Aralkylamines
Medchemexpress LLC Theodrenaline hydrochloride | 2572-61-4 | 411.84 | 5 MG
Theodrenaline hydrochloride is a cardiac stimulant that also functions as an anti-hypotensive agent when used in conjunction with Cafedrine. It has been shown to evoke a positive inotropic effect in human atrial trabeculae through the stimulation of β-adrenoceptors (AR).
- Cardiac stimulant
- Acts as an anti-hypotensive agent when combined with Cafedrine
- Evokes a positive inotropic effect in human atrial trabeculae by stimulating β-adrenoceptors
- May potentiate certain effects through phosphodiesterase (PDE) inhibition
- Targets phosphodiesterase (PDE)
- Part of the metabolic enzyme/protease pathway
![eMolecules 952958-78-0 | 4-(2-Aminoethyl)-5-(2-furyl)isoxazol-3(2h)-one | Combi-Blocks | MFCD09832473 | 194.190 | C9H10N2O3 | 95.000 | NCCc1c(o[nH]c1=O)-c1ccco1 | 1g | 205397142](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502188340.JPG-250.jpg)
eMolecules 952958-78-0 | 4-(2-Aminoethyl)-5-(2-furyl)isoxazol-3(2h)-one | Combi-Blocks | MFCD09832473 | 194.190 | C9H10N2O3 | 95.000 | NCCc1c(o[nH]c1=O)-c1ccco1 | 1g | 205397142
4-(2-Aminoethyl)-5-(2-furyl)isoxazol-3(2h)-one | Combi-Blocks | 952958-78-0 | MFCD09832473 | 194.190 | C9H10N2O3 | 95.000 | NCCc1c(o[nH]c1=O)-c1ccco1 | 1g | 205397142
Sigma Aldrich Fine Chemicals Biosciences Muscimol | 2763-96-4 | MFCD00057894 | 10mg
Muscimol | Mol Wt: 114.1 | 2763-96-4 | MFCD00057894 | 10mg
Medchemexpress LLC Fluoxetine-d5 hydrochloride | 1173020-43-3 | 99.9% | C17H14D5ClF3NO | 1 MG
Fluoxetine-d5 hydrochloride (LY 110140-d5) is a deuterium-labeled version of Fluoxetine hydrochloride. It serves as a tracer and internal standard for quantitative analysis using techniques like NMR, GC-MS, or LC-MS. Deuteration in drug molecules can influence pharmacokinetic and metabolic profiles, making this compound valuable for drug development research. This product is a solid, white to off-white in color, intended for research use only.
- Isotope-labeled compound
- Used as a tracer and internal standard
- Suitable for NMR, GC-MS, LC-MS analysis
- Deuterium-labeled Fluoxetine hydrochloride
- White to off-white solid appearance
Chem-Impex International, Inc. (R)-(+)-1-(1-Naphthyl)ethylamine | 3886-70-2 | MFCD00064114 | 5G
(R)-(+)-1-(1-Naphthyl)ethylamine, 3886-70-2, MFCD00064114, 5G
eMolecules 18110-40-2 | 2-AMINO-2-PHENYLPROPAN-1-OL HCL | AstaTech | MFCD27980708 | 187.670 | C9H14ClNO | 95.000 | Cl.CC(N)(CO)c1ccccc1 | 1g | 164728233
2-AMINO-2-PHENYLPROPAN-1-OL HCL | AstaTech | 18110-40-2 | MFCD27980708 | 187.670 | C9H14ClNO | 95.000 | Cl.CC(N)(CO)c1ccccc1 | 1g | 164728233
eMolecules 1607024-83-8 | Ambeed | (4-Methylisoxazol-5-yl)methanol | 100mg | 672839117 | A989148 | MFCD28549584 | 113.116 | C5H7NO2
Medchem Express | SBI-797812 | 5mg | 495800258 | HY-126255 | 2237268-08-3 | 402.470 | C19H22N4O4S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 171661-55-5 | (5-Methylthien-2-yl)methylamine hydrochloride | Combi-Blocks | MFCD09817548 | 163.660 | C6H10ClNS | 95.000 | Cl.Cc1ccc(CN)s1 | 1g | 117556066
(5-Methylthien-2-yl)methylamine hydrochloride | Combi-Blocks | 171661-55-5 | MFCD09817548 | 163.660 | C6H10ClNS | 95.000 | Cl.Cc1ccc(CN)s1 | 1g | 117556066
eMolecules 33866-44-3 | 3-(2-Furyl)isoxazol-5-amine | Chem-Impex | MFCD01754641 | 150.137 | C7H6N2O2 | 95.000 | Nc1cc(no1)-c1ccco1 | 1g | 272387852
3-(2-Furyl)isoxazol-5-amine | Chem-Impex | 33866-44-3 | MFCD01754641 | 150.137 | C7H6N2O2 | 95.000 | Nc1cc(no1)-c1ccco1 | 1g | 272387852
eMolecules 480438-80-0 | 3,3,3-Trifluoro-(2-piperidinylmethyl)propionic acid | Combi-Blocks, Inc. | MFCD03427205 | 225.211 | C9H14F3NO2 | 95.000 | OC(=O)C(CC1CCCCN1)C(F)(F)F | 1g | 603151957
3,3,3-Trifluoro-(2-piperidinylmethyl)propionic acid | Combi-Blocks, Inc. | 480438-80-0 | MFCD03427205 | 225.211 | C9H14F3NO2 | 95.000 | OC(=O)C(CC1CCCCN1)C(F)(F)F | 1g | 603151957
eMolecules 757949-48-7 | N-Cyclohexyl 1-BOC-piperidine-4-carboxamide | Combi-Blocks | MFCD08676418 | 310.438 | C17H30N2O3 | 96.000 | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)NC1CCCCC1 | 1g | 205385840
N-Cyclohexyl 1-BOC-piperidine-4-carboxamide | Combi-Blocks | 757949-48-7 | MFCD08676418 | 310.438 | C17H30N2O3 | 96.000 | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)NC1CCCCC1 | 1g | 205385840
eMolecules 81282-13-5 | (5-(4-Chlorophenyl)-3-isoxazolyl)methanol | Chem-Impex | MFCD01444076 | 209.630 | C10H8ClNO2 | 98.000 | OCc1cc(on1)-c1ccc(Cl)cc1 | 1g | 112762406
(5-(4-Chlorophenyl)-3-isoxazolyl)methanol | Chem-Impex | 81282-13-5 | MFCD01444076 | 209.630 | C10H8ClNO2 | 98.000 | OCc1cc(on1)-c1ccc(Cl)cc1 | 1g | 112762406
eMolecules 1159826-46-6 | 3-FMOC-AMINOMETHYL-PIPERIDINE HCL | AstaTech | MFCD11053010 | 372.890 | C21H25ClN2O2 | 97.000 | Cl.O=C(NCC1CCCNC1)OCC1c2ccccc2-c2ccccc12 | 5g | 112525668
3-FMOC-AMINOMETHYL-PIPERIDINE HCL | AstaTech | 1159826-46-6 | MFCD11053010 | 372.890 | C21H25ClN2O2 | 97.000 | Cl.O=C(NCC1CCCNC1)OCC1c2ccccc2-c2ccccc12 | 5g | 112525668