Protein Modification Reagents
![eMolecules 2112731-52-7 | N-(Azido-PEG3)-N-Boc-PEG3-acid | Broadpharm | MFCD30723234 | 522.596 | C22H42N4O10 | 98.000 | CC(C)(C)OC(=O)N(CCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCC(O)=O | 500mg | 343283696](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502203406.JPG-250.jpg)
eMolecules 2112731-52-7 | N-(Azido-PEG3)-N-Boc-PEG3-acid | Broadpharm | MFCD30723234 | 522.596 | C22H42N4O10 | 98.000 | CC(C)(C)OC(=O)N(CCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCC(O)=O | 500mg | 343283696
N-(Azido-PEG3)-N-Boc-PEG3-acid | Broadpharm | 2112731-52-7 | MFCD30723234 | 522.596 | C22H42N4O10 | 98.000 | CC(C)(C)OC(=O)N(CCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCC(O)=O | 500mg | 343283696
Worthington Biochemical Corporation CARBOXY PEPTIDASE 5MG
Chromatographically purified. A solution in 100 mM sodium chloride. Chymotrypsin and trypsin 2 0.02%.
Medchemexpress LLC 2,5-pyrrolidinedione derivative (PEG1 NHS ester) | 173414-89-6 | 97.0% | 627.55 g/mol | C26H33N3O15 | 100 MG
m-C-tri(CH2-PEG1-NHS ester) is a non-cleavable, single-unit polyethylene glycol (PEG) antibody-drug conjugate (ADC) linker bearing an N-hydroxysuccinimide (NHS) ester for amine coupling. Supplied as a solid for research use, it provides a stable, non-cleavable spacer that improves solubility and facilitates conjugation.
- Non-cleavable single-unit PEG linker for stable spacing
- NHS ester functionality for efficient amine conjugation
- Improves payload solubility
- Supplied as a solid with ~97.0% purity (NMR)
- Available in multiple sample sizes for research (50 mg-1 g)
![eMolecules 1355197-57-7 | Methylamino-PEG3-azide | Broadpharm | MFCD29042356 | 232.284 | C9H20N4O3 | 98.000 | CNCCOCCOCCOCCN=[N+]=[N-] | 1g | 296213413](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502203259.JPG-250.jpg)
eMolecules 1355197-57-7 | Methylamino-PEG3-azide | Broadpharm | MFCD29042356 | 232.284 | C9H20N4O3 | 98.000 | CNCCOCCOCCOCCN=[N+]=[N-] | 1g | 296213413
Methylamino-PEG3-azide | Broadpharm | 1355197-57-7 | MFCD29042356 | 232.284 | C9H20N4O3 | 98.000 | CNCCOCCOCCOCCN=[N+]=[N-] | 1g | 296213413
eMolecules 1402080-11-8 | Fmoc-PEG5-NHS ester | Broadpharm | MFCD28976702 | 628.675 | C32H40N2O11 | 98.000 | O=C(CCOCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12)ON1C(=O)CCC1=O | 1g | 343283761
Fmoc-PEG5-NHS ester | Broadpharm | 1402080-11-8 | MFCD28976702 | 628.675 | C32H40N2O11 | 98.000 | O=C(CCOCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12)ON1C(=O)CCC1=O | 1g | 343283761
![Medchemexpress LLC Poly(oxy-1,2-ethanediyl), α-[6-[[(3β)-cholest-5-en-3-yl]oxy]-1,6-dioxohexyl]-ω-[[6-[[(3β)-cho | 69068-97-9 | MFCD00151772 | 1055.60 g/mol | C68H110O8 | 100 MG](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000283629.png-250.jpg)
Medchemexpress LLC Poly(oxy-1,2-ethanediyl), α-[6-[[(3β)-cholest-5-en-3-yl]oxy]-1,6-dioxohexyl]-ω-[[6-[[(3β)-cho | 69068-97-9 | MFCD00151772 | 1055.60 g/mol | C68H110O8 | 100 MG
Cholesterol-PEG 600 is a cholesterol-polyethylene glycol conjugate used as an amphiphilic lipid modifier for liposome formulation and related life-science research. It enhances steric stabilization and aqueous compatibility of lipid assemblies, and is supplied as an off-white to light yellow oil with documented storage recommendations and batch-level quality documentation.
Medchemexpress LLC Amino-PEG5-CH2COOH | 141282-35-1 | >=97.0% | 50 MG
Amino-PEG5-CH2COOH is a PEG-based PROTAC linker essential for the synthesis of PROTACs. PROTACs are innovative molecules that feature two distinct ligands connected by a linker: one targets an E3 ubiquitin ligase, and the other binds to a specific target protein. This design allows PROTACs to leverage the intracellular ubiquitin-proteasome system for the selective degradation of target proteins.
- PEG-based PROTAC linker
- Used in the synthesis of PROTACs
- Enables PROTACs to exploit the ubiquitin-proteasome system
- Facilitates selective degradation of target proteins